- Tipsy updated
- Select2 combobox
48 files added
6 files modified
2 files deleted
| | |
| | | |
| | | <div class="form-group"> |
| | | <label for="data" class="col-sm-3 control-label">{tmpl_var name='public_key_txt'}</label> |
| | | <textarea name="data" readonly id="data" >{tmpl_var name='public_key'}</textarea> |
| | | <textarea readonly name="data" id="data" >{tmpl_var name='public_key'}</textarea> |
| | | </div> |
| | | <div class="form-group"> |
| | | <label for="selector" class="col-sm-3 control-label">{tmpl_var name='selector_txt'}</label> |
| | |
| | | <button class="btn btn-default formbutton-default" type="button" value="{tmpl_var name='btn_save_txt'}" onclick="submitForm('pageForm','dns/dns_dkim_edit.php');">{tmpl_var name='btn_save_txt'}</button> |
| | | <button class="negative iconstxt icoNegative" type="button" value="{tmpl_var name='btn_cancel_txt'}" data-load-content="dns/dns_soa_edit.php?id={tmpl_var name='zone'}"><span>{tmpl_var name='btn_cancel_txt'}</span></button> |
| | | </div></div> |
| | | |
| | |
| | | return (typeof thing == 'function') ? (thing.call(ctx)) : thing;
|
| | | };
|
| | |
|
| | | function isElementInDOM(ele) { |
| | | while (ele = ele.parentNode) { |
| | | if (ele == document) return true; |
| | | } |
| | | return false; |
| | | }; |
| | | |
| | | function Tipsy(element, options) {
|
| | | this.$element = $(element);
|
| | | this.options = options;
|
| | |
| | | tip: function() {
|
| | | if (!this.$tip) {
|
| | | this.$tip = $('<div class="tipsy"></div>').html('<div class="tipsy-arrow"></div><div class="tipsy-inner"></div>');
|
| | | this.$tip.data('tipsy-pointee', this.$element[0]); |
| | | }
|
| | | return this.$tip;
|
| | | },
|
| | |
| | | if (!options.live) this.each(function() { get(this); });
|
| | |
|
| | | if (options.trigger != 'manual') {
|
| | | var binder = options.live ? 'on' : 'bind',
|
| | | var binder = options.live ? 'live' : 'bind', |
| | | eventIn = options.trigger == 'hover' ? 'mouseenter' : 'focus',
|
| | | eventOut = options.trigger == 'hover' ? 'mouseleave' : 'blur';
|
| | | this[binder](eventIn, enter)[binder](eventOut, leave);
|
| | |
| | | opacity: 0.8,
|
| | | title: 'title',
|
| | | trigger: 'hover'
|
| | | }; |
| | | |
| | | $.fn.tipsy.revalidate = function() { |
| | | $('.tipsy').each(function() { |
| | | var pointee = $.data(this, 'tipsy-pointee'); |
| | | if (!pointee || !isElementInDOM(pointee)) { |
| | | $(this).remove(); |
| | | } |
| | | }); |
| | | };
|
| | |
|
| | | // Overwrite this method to provide options on a per-element basis.
|
| | |
| | | }
|
| | | };
|
| | |
|
| | | })(jQuery);
|
| | |
|
| | |
|
| | |
|
| | | (function( $ ) {
|
| | | $.widget( "ui.combobox", {
|
| | | _create: function() {
|
| | | var elwidth = this.element.width();
|
| | | var elheight = this.element.height();
|
| | | var input,
|
| | | self = this,
|
| | | select = this.element,
|
| | | internal = false,
|
| | | selected = select.children( ":selected" ),
|
| | | value = selected.val() ? selected.text() : "",
|
| | | wrapper = this.wrapper = $( "<span>" )
|
| | | .addClass( "ui-combobox" )
|
| | | .insertAfter( select );
|
| | | |
| | | input = $( "<input>" ).css( { "width": (select.is(':visible') ? (elwidth > 15 ? elwidth - 15 : 1) : 350), "height": (elheight > 0 ? elheight : 16) });
|
| | | select.hide();
|
| | | input.appendTo( wrapper )
|
| | | .val( value )
|
| | | .addClass( "ui-state-default ui-combobox-input" )
|
| | | .autocomplete({
|
| | | delay: 0,
|
| | | minLength: 0,
|
| | | source: function( request, response ) {
|
| | | var matcher = new RegExp( $.ui.autocomplete.escapeRegex(request.term), "i" );
|
| | | response( select.children( "option" ).map(function() {
|
| | | var text = $( this ).text();
|
| | | //if ( this.value && ( !request.term || matcher.test(text) ) )
|
| | | if ( (!request.term || matcher.test(text)) && $(this).css('display') != 'none' )
|
| | | return {
|
| | | label: (text == "" ? " " : text.replace(
|
| | | new RegExp(
|
| | | "(?![^&;]+;)(?!<[^<>]*)(" +
|
| | | $.ui.autocomplete.escapeRegex(request.term) +
|
| | | ")(?![^<>]*>)(?![^&;]+;)", "gi"
|
| | | ), "<strong>$1</strong>" )),
|
| | | 'value': (text ? text : ''),
|
| | | 'class': (select.hasClass('flags') ? 'country-' + ($(this).val() ? $(this).val().toUpperCase() : '') : $(this).attr('class')),
|
| | | option: this
|
| | | };
|
| | | }) );
|
| | | },
|
| | | select: function( event, ui ) {
|
| | | ui.item.option.selected = true;
|
| | | self._trigger( "selected", event, {
|
| | | item: ui.item.option
|
| | | });
|
| | | if((select.onchange || false) && typeof select.onchange == 'function') {
|
| | | select.onchange( { target: select } );
|
| | | } else if($(select).attr('onchange')) {
|
| | | eval($(select).attr('onchange'));
|
| | | } else {
|
| | | if(!ui.item.internal) {
|
| | | internal = true;
|
| | | $(select).change();
|
| | | }
|
| | | }
|
| | | if (jQuery(".panel #Filter").length > 0) {
|
| | | jQuery(".panel #Filter").trigger('click');
|
| | | }
|
| | | },
|
| | | change: function( event, ui ) {
|
| | | if ( !ui.item ) {
|
| | | var matcher = new RegExp( "" + $.ui.autocomplete.escapeRegex( $(this).val() ) + "", "i" ),
|
| | | matchtext = $(this).val();
|
| | | valid = false;
|
| | | select.children( "option" ).each(function() {
|
| | | if( (($(this).text() == "" && matchtext == "") || $( this ).text().match( matcher )) && $(this).css('display') != 'none' ) {
|
| | | select.val($(this).val());
|
| | | this.selected = valid = true;
|
| | | return false;
|
| | | }
|
| | | });
|
| | | if ( !valid ) {
|
| | | // remove invalid value, as it didn't match anything
|
| | | $( this ).val( "" );
|
| | | select.val( "" );
|
| | | input.data( "autocomplete" ).term = "";
|
| | | return false;
|
| | | }
|
| | | }
|
| | | }
|
| | | })
|
| | | .keypress(function(event) {
|
| | | if(select.attr('disabled')) {
|
| | | event.preventDefault();
|
| | | return false;
|
| | | }
|
| | | if(event.keyCode == 13) {
|
| | | event.preventDefault();
|
| | | var matcher = new RegExp( "" + $.ui.autocomplete.escapeRegex( $(this).val() ) + "", "i" ),
|
| | | matchtext = $(this).val();
|
| | | valid = false,
|
| | | selected = false;
|
| | | select.children( "option" ).each(function() {
|
| | | if( (($(this).val() == "" && matchtext == "") || $( this ).text().match( matcher )) && $(this).css('display') != 'none' ) {
|
| | | valid = true;
|
| | | selected = $(this);
|
| | | return false;
|
| | | }
|
| | | });
|
| | | if(!valid) return false;
|
| | | |
| | | $(this).autocomplete('option','select').call($(this), event, { item: { option: selected.get(0), internal: true } });
|
| | | }
|
| | | })
|
| | | .addClass( "ui-widget ui-widget-content ui-corner-left" )
|
| | | .click(function() {
|
| | | if(select.attr('disabled')) {
|
| | | event.preventDefault();
|
| | | return false;
|
| | | }
|
| | | // close if already visible
|
| | | if ( input.autocomplete( "widget" ).is( ":visible" ) ) {
|
| | | //input.autocomplete( "close" );
|
| | | return;
|
| | | }
|
| | |
|
| | | // pass empty string as value to search for, displaying all results
|
| | | input.autocomplete( "search", "" );
|
| | | input.focus();
|
| | | });
|
| | | if(select.hasClass('flags')) input.addClass('flags');
|
| | |
|
| | | input.data( "autocomplete" )._renderItem = function( ul, item ) {
|
| | | var el = $( "<li></li>" )
|
| | | .data( "item.autocomplete", item )
|
| | | .append( "<a>" + item.label + "</a>" )
|
| | | .appendTo( ul );
|
| | | if(item && item['class'] && el) el.addClass(item['class']);
|
| | | return el;
|
| | | };
|
| | | select.change(function(e) {
|
| | | if(internal == true) {
|
| | | internal = false;
|
| | | return;
|
| | | }
|
| | | var matchtext = $(this).val().toLowerCase();
|
| | | valid = false,
|
| | | selected = false,
|
| | | selected_val = "";
|
| | | select.children( "option" ).each(function() {
|
| | | if( (($(this).val() == "" && matchtext == "") || $( this ).val().toLowerCase() == matchtext) && $(this).css('display') != 'none' ) {
|
| | | valid = true;
|
| | | selected = $(this);
|
| | | selected_val = $(this).text();
|
| | | return false;
|
| | | }
|
| | | });
|
| | | if(!valid) return false;
|
| | | |
| | | input.val(selected_val).autocomplete('option','select').call(input, (e ? e : {target: select}), { item: { option: selected.get(0), internal: true } });
|
| | | });
|
| | |
|
| | | $( "<a>" )
|
| | | .attr( "tabIndex", -1 )
|
| | | .attr( "title", "Show All Items" )
|
| | | .appendTo( wrapper )
|
| | | .button({
|
| | | icons: {
|
| | | primary: "ui-icon-triangle-1-s"
|
| | | },
|
| | | text: false
|
| | | })
|
| | | .removeClass( "ui-corner-all" )
|
| | | .addClass( "ui-corner-right ui-combobox-toggle" )
|
| | | .css( { "width": 15, "height": (elheight > 0 ? elheight : 16) })
|
| | | .click(function() {
|
| | | if(select.attr('disabled')) {
|
| | | event.preventDefault();
|
| | | return false;
|
| | | }
|
| | | // close if already visible
|
| | | if ( input.autocomplete( "widget" ).is( ":visible" ) ) {
|
| | | input.autocomplete( "close" );
|
| | | return;
|
| | | }
|
| | |
|
| | | // work around a bug (likely same cause as #5265)
|
| | | $( this ).blur();
|
| | |
|
| | | // pass empty string as value to search for, displaying all results
|
| | | input.autocomplete( "search", "" );
|
| | | input.focus();
|
| | | });
|
| | | },
|
| | |
|
| | | destroy: function() {
|
| | | this.wrapper.remove();
|
| | | this.element.show();
|
| | | $.Widget.prototype.destroy.call( this );
|
| | | }
|
| | | });
|
| | | })( jQuery );
|
| | |
| | | ?> |
| | | |
| | | |
| | | $('#pageContent').find("select:not(.chosen-select)").combobox({ |
| | | select: function (event, ui) { |
| | | $('#pageContent').find("select:not(.chosen-select)").select2({ |
| | | placeholder: '', |
| | | width: 'element', |
| | | allowClear: true, |
| | | }).on('change', function(e) { |
| | | if (jQuery(".panel #Filter").length > 0) { |
| | | jQuery(".panel #Filter").trigger('click'); |
| | | } |
| | | } |
| | | }); |
| | | /* TODO: find a better way! */ |
| New file |
| | |
| | | /* |
| | | Copyright 2014 Igor Vaynberg |
| | | |
| | | Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014 |
| | | |
| | | This software is licensed under the Apache License, Version 2.0 (the "Apache License") or the GNU |
| | | General Public License version 2 (the "GPL License"). You may choose either license to govern your |
| | | use of this software only upon the condition that you accept all of the terms of either the Apache |
| | | License or the GPL License. |
| | | |
| | | You may obtain a copy of the Apache License and the GPL License at: |
| | | |
| | | http://www.apache.org/licenses/LICENSE-2.0 |
| | | http://www.gnu.org/licenses/gpl-2.0.html |
| | | |
| | | Unless required by applicable law or agreed to in writing, software distributed under the Apache License |
| | | or the GPL Licesnse is distributed on an "AS IS" BASIS, WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, |
| | | either express or implied. See the Apache License and the GPL License for the specific language governing |
| | | permissions and limitations under the Apache License and the GPL License. |
| | | */ |
| | | !function(a){"undefined"==typeof a.fn.each2&&a.extend(a.fn,{each2:function(b){for(var c=a([0]),d=-1,e=this.length;++d<e&&(c.context=c[0]=this[d])&&b.call(c[0],d,c)!==!1;);return this}})}(jQuery),function(a,b){"use strict";function n(b){var c=a(document.createTextNode(""));b.before(c),c.before(b),c.remove()}function o(a){function b(a){return m[a]||a}return a.replace(/[^\u0000-\u007E]/g,b)}function p(a,b){for(var c=0,d=b.length;d>c;c+=1)if(r(a,b[c]))return c;return-1}function q(){var b=a(l);b.appendTo(document.body);var c={width:b.width()-b[0].clientWidth,height:b.height()-b[0].clientHeight};return b.remove(),c}function r(a,c){return a===c?!0:a===b||c===b?!1:null===a||null===c?!1:a.constructor===String?a+""==c+"":c.constructor===String?c+""==a+"":!1}function s(a,b,c){var d,e,f;if(null===a||a.length<1)return[];for(d=a.split(b),e=0,f=d.length;f>e;e+=1)d[e]=c(d[e]);return d}function t(a){return a.outerWidth(!1)-a.width()}function u(c){var d="keyup-change-value";c.on("keydown",function(){a.data(c,d)===b&&a.data(c,d,c.val())}),c.on("keyup",function(){var e=a.data(c,d);e!==b&&c.val()!==e&&(a.removeData(c,d),c.trigger("keyup-change"))})}function v(c){c.on("mousemove",function(c){var d=h;(d===b||d.x!==c.pageX||d.y!==c.pageY)&&a(c.target).trigger("mousemove-filtered",c)})}function w(a,c,d){d=d||b;var e;return function(){var b=arguments;window.clearTimeout(e),e=window.setTimeout(function(){c.apply(d,b)},a)}}function x(a,b){var c=w(a,function(a){b.trigger("scroll-debounced",a)});b.on("scroll",function(a){p(a.target,b.get())>=0&&c(a)})}function y(a){a[0]!==document.activeElement&&window.setTimeout(function(){var d,b=a[0],c=a.val().length;a.focus();var e=b.offsetWidth>0||b.offsetHeight>0;e&&b===document.activeElement&&(b.setSelectionRange?b.setSelectionRange(c,c):b.createTextRange&&(d=b.createTextRange(),d.collapse(!1),d.select()))},0)}function z(b){b=a(b)[0];var c=0,d=0;if("selectionStart"in b)c=b.selectionStart,d=b.selectionEnd-c;else if("selection"in document){b.focus();var e=document.selection.createRange();d=document.selection.createRange().text.length,e.moveStart("character",-b.value.length),c=e.text.length-d}return{offset:c,length:d}}function A(a){a.preventDefault(),a.stopPropagation()}function B(a){a.preventDefault(),a.stopImmediatePropagation()}function C(b){if(!g){var c=b[0].currentStyle||window.getComputedStyle(b[0],null);g=a(document.createElement("div")).css({position:"absolute",left:"-10000px",top:"-10000px",display:"none",fontSize:c.fontSize,fontFamily:c.fontFamily,fontStyle:c.fontStyle,fontWeight:c.fontWeight,letterSpacing:c.letterSpacing,textTransform:c.textTransform,whiteSpace:"nowrap"}),g.attr("class","select2-sizer"),a(document.body).append(g)}return g.text(b.val()),g.width()}function D(b,c,d){var e,g,f=[];e=a.trim(b.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0===this.indexOf("select2-")&&f.push(this)})),e=a.trim(c.attr("class")),e&&(e=""+e,a(e.split(/\s+/)).each2(function(){0!==this.indexOf("select2-")&&(g=d(this),g&&f.push(g))})),b.attr("class",f.join(" "))}function E(a,b,c,d){var e=o(a.toUpperCase()).indexOf(o(b.toUpperCase())),f=b.length;return 0>e?(c.push(d(a)),void 0):(c.push(d(a.substring(0,e))),c.push("<span class='select2-match'>"),c.push(d(a.substring(e,e+f))),c.push("</span>"),c.push(d(a.substring(e+f,a.length))),void 0)}function F(a){var b={"\\":"\","&":"&","<":"<",">":">",'"':""","'":"'","/":"/"};return String(a).replace(/[&<>"'\/\\]/g,function(a){return b[a]})}function G(c){var d,e=null,f=c.quietMillis||100,g=c.url,h=this;return function(i){window.clearTimeout(d),d=window.setTimeout(function(){var d=c.data,f=g,j=c.transport||a.fn.select2.ajaxDefaults.transport,k={type:c.type||"GET",cache:c.cache||!1,jsonpCallback:c.jsonpCallback||b,dataType:c.dataType||"json"},l=a.extend({},a.fn.select2.ajaxDefaults.params,k);d=d?d.call(h,i.term,i.page,i.context):null,f="function"==typeof f?f.call(h,i.term,i.page,i.context):f,e&&"function"==typeof e.abort&&e.abort(),c.params&&(a.isFunction(c.params)?a.extend(l,c.params.call(h)):a.extend(l,c.params)),a.extend(l,{url:f,dataType:c.dataType,data:d,success:function(a){var b=c.results(a,i.page,i);i.callback(b)},error:function(a,b,c){var d={hasError:!0,jqXHR:a,textStatus:b,errorThrown:c};i.callback(d)}}),e=j.call(h,l)},f)}}function H(b){var d,e,c=b,f=function(a){return""+a.text};a.isArray(c)&&(e=c,c={results:e}),a.isFunction(c)===!1&&(e=c,c=function(){return e});var g=c();return g.text&&(f=g.text,a.isFunction(f)||(d=g.text,f=function(a){return a[d]})),function(b){var g,d=b.term,e={results:[]};return""===d?(b.callback(c()),void 0):(g=function(c,e){var h,i;if(c=c[0],c.children){h={};for(i in c)c.hasOwnProperty(i)&&(h[i]=c[i]);h.children=[],a(c.children).each2(function(a,b){g(b,h.children)}),(h.children.length||b.matcher(d,f(h),c))&&e.push(h)}else b.matcher(d,f(c),c)&&e.push(c)},a(c().results).each2(function(a,b){g(b,e.results)}),b.callback(e),void 0)}}function I(c){var d=a.isFunction(c);return function(e){var f=e.term,g={results:[]},h=d?c(e):c;a.isArray(h)&&(a(h).each(function(){var a=this.text!==b,c=a?this.text:this;(""===f||e.matcher(f,c))&&g.results.push(a?this:{id:this,text:this})}),e.callback(g))}}function J(b,c){if(a.isFunction(b))return!0;if(!b)return!1;if("string"==typeof b)return!0;throw new Error(c+" must be a string, function, or falsy value")}function K(b,c){if(a.isFunction(b)){var d=Array.prototype.slice.call(arguments,2);return b.apply(c,d)}return b}function L(b){var c=0;return a.each(b,function(a,b){b.children?c+=L(b.children):c++}),c}function M(a,c,d,e){var h,i,j,k,l,f=a,g=!1;if(!e.createSearchChoice||!e.tokenSeparators||e.tokenSeparators.length<1)return b;for(;;){for(i=-1,j=0,k=e.tokenSeparators.length;k>j&&(l=e.tokenSeparators[j],i=a.indexOf(l),!(i>=0));j++);if(0>i)break;if(h=a.substring(0,i),a=a.substring(i+l.length),h.length>0&&(h=e.createSearchChoice.call(this,h,c),h!==b&&null!==h&&e.id(h)!==b&&null!==e.id(h))){for(g=!1,j=0,k=c.length;k>j;j++)if(r(e.id(h),e.id(c[j]))){g=!0;break}g||d(h)}}return f!==a?a:void 0}function N(){var b=this;a.each(arguments,function(a,c){b[c].remove(),b[c]=null})}function O(b,c){var d=function(){};return d.prototype=new b,d.prototype.constructor=d,d.prototype.parent=b.prototype,d.prototype=a.extend(d.prototype,c),d}if(window.Select2===b){var c,d,e,f,g,i,j,h={x:0,y:0},k={TAB:9,ENTER:13,ESC:27,SPACE:32,LEFT:37,UP:38,RIGHT:39,DOWN:40,SHIFT:16,CTRL:17,ALT:18,PAGE_UP:33,PAGE_DOWN:34,HOME:36,END:35,BACKSPACE:8,DELETE:46,isArrow:function(a){switch(a=a.which?a.which:a){case k.LEFT:case k.RIGHT:case k.UP:case k.DOWN:return!0}return!1},isControl:function(a){var b=a.which;switch(b){case k.SHIFT:case k.CTRL:case k.ALT:return!0}return a.metaKey?!0:!1},isFunctionKey:function(a){return a=a.which?a.which:a,a>=112&&123>=a}},l="<div class='select2-measure-scrollbar'></div>",m={"\u24b6":"A","\uff21":"A","\xc0":"A","\xc1":"A","\xc2":"A","\u1ea6":"A","\u1ea4":"A","\u1eaa":"A","\u1ea8":"A","\xc3":"A","\u0100":"A","\u0102":"A","\u1eb0":"A","\u1eae":"A","\u1eb4":"A","\u1eb2":"A","\u0226":"A","\u01e0":"A","\xc4":"A","\u01de":"A","\u1ea2":"A","\xc5":"A","\u01fa":"A","\u01cd":"A","\u0200":"A","\u0202":"A","\u1ea0":"A","\u1eac":"A","\u1eb6":"A","\u1e00":"A","\u0104":"A","\u023a":"A","\u2c6f":"A","\ua732":"AA","\xc6":"AE","\u01fc":"AE","\u01e2":"AE","\ua734":"AO","\ua736":"AU","\ua738":"AV","\ua73a":"AV","\ua73c":"AY","\u24b7":"B","\uff22":"B","\u1e02":"B","\u1e04":"B","\u1e06":"B","\u0243":"B","\u0182":"B","\u0181":"B","\u24b8":"C","\uff23":"C","\u0106":"C","\u0108":"C","\u010a":"C","\u010c":"C","\xc7":"C","\u1e08":"C","\u0187":"C","\u023b":"C","\ua73e":"C","\u24b9":"D","\uff24":"D","\u1e0a":"D","\u010e":"D","\u1e0c":"D","\u1e10":"D","\u1e12":"D","\u1e0e":"D","\u0110":"D","\u018b":"D","\u018a":"D","\u0189":"D","\ua779":"D","\u01f1":"DZ","\u01c4":"DZ","\u01f2":"Dz","\u01c5":"Dz","\u24ba":"E","\uff25":"E","\xc8":"E","\xc9":"E","\xca":"E","\u1ec0":"E","\u1ebe":"E","\u1ec4":"E","\u1ec2":"E","\u1ebc":"E","\u0112":"E","\u1e14":"E","\u1e16":"E","\u0114":"E","\u0116":"E","\xcb":"E","\u1eba":"E","\u011a":"E","\u0204":"E","\u0206":"E","\u1eb8":"E","\u1ec6":"E","\u0228":"E","\u1e1c":"E","\u0118":"E","\u1e18":"E","\u1e1a":"E","\u0190":"E","\u018e":"E","\u24bb":"F","\uff26":"F","\u1e1e":"F","\u0191":"F","\ua77b":"F","\u24bc":"G","\uff27":"G","\u01f4":"G","\u011c":"G","\u1e20":"G","\u011e":"G","\u0120":"G","\u01e6":"G","\u0122":"G","\u01e4":"G","\u0193":"G","\ua7a0":"G","\ua77d":"G","\ua77e":"G","\u24bd":"H","\uff28":"H","\u0124":"H","\u1e22":"H","\u1e26":"H","\u021e":"H","\u1e24":"H","\u1e28":"H","\u1e2a":"H","\u0126":"H","\u2c67":"H","\u2c75":"H","\ua78d":"H","\u24be":"I","\uff29":"I","\xcc":"I","\xcd":"I","\xce":"I","\u0128":"I","\u012a":"I","\u012c":"I","\u0130":"I","\xcf":"I","\u1e2e":"I","\u1ec8":"I","\u01cf":"I","\u0208":"I","\u020a":"I","\u1eca":"I","\u012e":"I","\u1e2c":"I","\u0197":"I","\u24bf":"J","\uff2a":"J","\u0134":"J","\u0248":"J","\u24c0":"K","\uff2b":"K","\u1e30":"K","\u01e8":"K","\u1e32":"K","\u0136":"K","\u1e34":"K","\u0198":"K","\u2c69":"K","\ua740":"K","\ua742":"K","\ua744":"K","\ua7a2":"K","\u24c1":"L","\uff2c":"L","\u013f":"L","\u0139":"L","\u013d":"L","\u1e36":"L","\u1e38":"L","\u013b":"L","\u1e3c":"L","\u1e3a":"L","\u0141":"L","\u023d":"L","\u2c62":"L","\u2c60":"L","\ua748":"L","\ua746":"L","\ua780":"L","\u01c7":"LJ","\u01c8":"Lj","\u24c2":"M","\uff2d":"M","\u1e3e":"M","\u1e40":"M","\u1e42":"M","\u2c6e":"M","\u019c":"M","\u24c3":"N","\uff2e":"N","\u01f8":"N","\u0143":"N","\xd1":"N","\u1e44":"N","\u0147":"N","\u1e46":"N","\u0145":"N","\u1e4a":"N","\u1e48":"N","\u0220":"N","\u019d":"N","\ua790":"N","\ua7a4":"N","\u01ca":"NJ","\u01cb":"Nj","\u24c4":"O","\uff2f":"O","\xd2":"O","\xd3":"O","\xd4":"O","\u1ed2":"O","\u1ed0":"O","\u1ed6":"O","\u1ed4":"O","\xd5":"O","\u1e4c":"O","\u022c":"O","\u1e4e":"O","\u014c":"O","\u1e50":"O","\u1e52":"O","\u014e":"O","\u022e":"O","\u0230":"O","\xd6":"O","\u022a":"O","\u1ece":"O","\u0150":"O","\u01d1":"O","\u020c":"O","\u020e":"O","\u01a0":"O","\u1edc":"O","\u1eda":"O","\u1ee0":"O","\u1ede":"O","\u1ee2":"O","\u1ecc":"O","\u1ed8":"O","\u01ea":"O","\u01ec":"O","\xd8":"O","\u01fe":"O","\u0186":"O","\u019f":"O","\ua74a":"O","\ua74c":"O","\u01a2":"OI","\ua74e":"OO","\u0222":"OU","\u24c5":"P","\uff30":"P","\u1e54":"P","\u1e56":"P","\u01a4":"P","\u2c63":"P","\ua750":"P","\ua752":"P","\ua754":"P","\u24c6":"Q","\uff31":"Q","\ua756":"Q","\ua758":"Q","\u024a":"Q","\u24c7":"R","\uff32":"R","\u0154":"R","\u1e58":"R","\u0158":"R","\u0210":"R","\u0212":"R","\u1e5a":"R","\u1e5c":"R","\u0156":"R","\u1e5e":"R","\u024c":"R","\u2c64":"R","\ua75a":"R","\ua7a6":"R","\ua782":"R","\u24c8":"S","\uff33":"S","\u1e9e":"S","\u015a":"S","\u1e64":"S","\u015c":"S","\u1e60":"S","\u0160":"S","\u1e66":"S","\u1e62":"S","\u1e68":"S","\u0218":"S","\u015e":"S","\u2c7e":"S","\ua7a8":"S","\ua784":"S","\u24c9":"T","\uff34":"T","\u1e6a":"T","\u0164":"T","\u1e6c":"T","\u021a":"T","\u0162":"T","\u1e70":"T","\u1e6e":"T","\u0166":"T","\u01ac":"T","\u01ae":"T","\u023e":"T","\ua786":"T","\ua728":"TZ","\u24ca":"U","\uff35":"U","\xd9":"U","\xda":"U","\xdb":"U","\u0168":"U","\u1e78":"U","\u016a":"U","\u1e7a":"U","\u016c":"U","\xdc":"U","\u01db":"U","\u01d7":"U","\u01d5":"U","\u01d9":"U","\u1ee6":"U","\u016e":"U","\u0170":"U","\u01d3":"U","\u0214":"U","\u0216":"U","\u01af":"U","\u1eea":"U","\u1ee8":"U","\u1eee":"U","\u1eec":"U","\u1ef0":"U","\u1ee4":"U","\u1e72":"U","\u0172":"U","\u1e76":"U","\u1e74":"U","\u0244":"U","\u24cb":"V","\uff36":"V","\u1e7c":"V","\u1e7e":"V","\u01b2":"V","\ua75e":"V","\u0245":"V","\ua760":"VY","\u24cc":"W","\uff37":"W","\u1e80":"W","\u1e82":"W","\u0174":"W","\u1e86":"W","\u1e84":"W","\u1e88":"W","\u2c72":"W","\u24cd":"X","\uff38":"X","\u1e8a":"X","\u1e8c":"X","\u24ce":"Y","\uff39":"Y","\u1ef2":"Y","\xdd":"Y","\u0176":"Y","\u1ef8":"Y","\u0232":"Y","\u1e8e":"Y","\u0178":"Y","\u1ef6":"Y","\u1ef4":"Y","\u01b3":"Y","\u024e":"Y","\u1efe":"Y","\u24cf":"Z","\uff3a":"Z","\u0179":"Z","\u1e90":"Z","\u017b":"Z","\u017d":"Z","\u1e92":"Z","\u1e94":"Z","\u01b5":"Z","\u0224":"Z","\u2c7f":"Z","\u2c6b":"Z","\ua762":"Z","\u24d0":"a","\uff41":"a","\u1e9a":"a","\xe0":"a","\xe1":"a","\xe2":"a","\u1ea7":"a","\u1ea5":"a","\u1eab":"a","\u1ea9":"a","\xe3":"a","\u0101":"a","\u0103":"a","\u1eb1":"a","\u1eaf":"a","\u1eb5":"a","\u1eb3":"a","\u0227":"a","\u01e1":"a","\xe4":"a","\u01df":"a","\u1ea3":"a","\xe5":"a","\u01fb":"a","\u01ce":"a","\u0201":"a","\u0203":"a","\u1ea1":"a","\u1ead":"a","\u1eb7":"a","\u1e01":"a","\u0105":"a","\u2c65":"a","\u0250":"a","\ua733":"aa","\xe6":"ae","\u01fd":"ae","\u01e3":"ae","\ua735":"ao","\ua737":"au","\ua739":"av","\ua73b":"av","\ua73d":"ay","\u24d1":"b","\uff42":"b","\u1e03":"b","\u1e05":"b","\u1e07":"b","\u0180":"b","\u0183":"b","\u0253":"b","\u24d2":"c","\uff43":"c","\u0107":"c","\u0109":"c","\u010b":"c","\u010d":"c","\xe7":"c","\u1e09":"c","\u0188":"c","\u023c":"c","\ua73f":"c","\u2184":"c","\u24d3":"d","\uff44":"d","\u1e0b":"d","\u010f":"d","\u1e0d":"d","\u1e11":"d","\u1e13":"d","\u1e0f":"d","\u0111":"d","\u018c":"d","\u0256":"d","\u0257":"d","\ua77a":"d","\u01f3":"dz","\u01c6":"dz","\u24d4":"e","\uff45":"e","\xe8":"e","\xe9":"e","\xea":"e","\u1ec1":"e","\u1ebf":"e","\u1ec5":"e","\u1ec3":"e","\u1ebd":"e","\u0113":"e","\u1e15":"e","\u1e17":"e","\u0115":"e","\u0117":"e","\xeb":"e","\u1ebb":"e","\u011b":"e","\u0205":"e","\u0207":"e","\u1eb9":"e","\u1ec7":"e","\u0229":"e","\u1e1d":"e","\u0119":"e","\u1e19":"e","\u1e1b":"e","\u0247":"e","\u025b":"e","\u01dd":"e","\u24d5":"f","\uff46":"f","\u1e1f":"f","\u0192":"f","\ua77c":"f","\u24d6":"g","\uff47":"g","\u01f5":"g","\u011d":"g","\u1e21":"g","\u011f":"g","\u0121":"g","\u01e7":"g","\u0123":"g","\u01e5":"g","\u0260":"g","\ua7a1":"g","\u1d79":"g","\ua77f":"g","\u24d7":"h","\uff48":"h","\u0125":"h","\u1e23":"h","\u1e27":"h","\u021f":"h","\u1e25":"h","\u1e29":"h","\u1e2b":"h","\u1e96":"h","\u0127":"h","\u2c68":"h","\u2c76":"h","\u0265":"h","\u0195":"hv","\u24d8":"i","\uff49":"i","\xec":"i","\xed":"i","\xee":"i","\u0129":"i","\u012b":"i","\u012d":"i","\xef":"i","\u1e2f":"i","\u1ec9":"i","\u01d0":"i","\u0209":"i","\u020b":"i","\u1ecb":"i","\u012f":"i","\u1e2d":"i","\u0268":"i","\u0131":"i","\u24d9":"j","\uff4a":"j","\u0135":"j","\u01f0":"j","\u0249":"j","\u24da":"k","\uff4b":"k","\u1e31":"k","\u01e9":"k","\u1e33":"k","\u0137":"k","\u1e35":"k","\u0199":"k","\u2c6a":"k","\ua741":"k","\ua743":"k","\ua745":"k","\ua7a3":"k","\u24db":"l","\uff4c":"l","\u0140":"l","\u013a":"l","\u013e":"l","\u1e37":"l","\u1e39":"l","\u013c":"l","\u1e3d":"l","\u1e3b":"l","\u017f":"l","\u0142":"l","\u019a":"l","\u026b":"l","\u2c61":"l","\ua749":"l","\ua781":"l","\ua747":"l","\u01c9":"lj","\u24dc":"m","\uff4d":"m","\u1e3f":"m","\u1e41":"m","\u1e43":"m","\u0271":"m","\u026f":"m","\u24dd":"n","\uff4e":"n","\u01f9":"n","\u0144":"n","\xf1":"n","\u1e45":"n","\u0148":"n","\u1e47":"n","\u0146":"n","\u1e4b":"n","\u1e49":"n","\u019e":"n","\u0272":"n","\u0149":"n","\ua791":"n","\ua7a5":"n","\u01cc":"nj","\u24de":"o","\uff4f":"o","\xf2":"o","\xf3":"o","\xf4":"o","\u1ed3":"o","\u1ed1":"o","\u1ed7":"o","\u1ed5":"o","\xf5":"o","\u1e4d":"o","\u022d":"o","\u1e4f":"o","\u014d":"o","\u1e51":"o","\u1e53":"o","\u014f":"o","\u022f":"o","\u0231":"o","\xf6":"o","\u022b":"o","\u1ecf":"o","\u0151":"o","\u01d2":"o","\u020d":"o","\u020f":"o","\u01a1":"o","\u1edd":"o","\u1edb":"o","\u1ee1":"o","\u1edf":"o","\u1ee3":"o","\u1ecd":"o","\u1ed9":"o","\u01eb":"o","\u01ed":"o","\xf8":"o","\u01ff":"o","\u0254":"o","\ua74b":"o","\ua74d":"o","\u0275":"o","\u01a3":"oi","\u0223":"ou","\ua74f":"oo","\u24df":"p","\uff50":"p","\u1e55":"p","\u1e57":"p","\u01a5":"p","\u1d7d":"p","\ua751":"p","\ua753":"p","\ua755":"p","\u24e0":"q","\uff51":"q","\u024b":"q","\ua757":"q","\ua759":"q","\u24e1":"r","\uff52":"r","\u0155":"r","\u1e59":"r","\u0159":"r","\u0211":"r","\u0213":"r","\u1e5b":"r","\u1e5d":"r","\u0157":"r","\u1e5f":"r","\u024d":"r","\u027d":"r","\ua75b":"r","\ua7a7":"r","\ua783":"r","\u24e2":"s","\uff53":"s","\xdf":"s","\u015b":"s","\u1e65":"s","\u015d":"s","\u1e61":"s","\u0161":"s","\u1e67":"s","\u1e63":"s","\u1e69":"s","\u0219":"s","\u015f":"s","\u023f":"s","\ua7a9":"s","\ua785":"s","\u1e9b":"s","\u24e3":"t","\uff54":"t","\u1e6b":"t","\u1e97":"t","\u0165":"t","\u1e6d":"t","\u021b":"t","\u0163":"t","\u1e71":"t","\u1e6f":"t","\u0167":"t","\u01ad":"t","\u0288":"t","\u2c66":"t","\ua787":"t","\ua729":"tz","\u24e4":"u","\uff55":"u","\xf9":"u","\xfa":"u","\xfb":"u","\u0169":"u","\u1e79":"u","\u016b":"u","\u1e7b":"u","\u016d":"u","\xfc":"u","\u01dc":"u","\u01d8":"u","\u01d6":"u","\u01da":"u","\u1ee7":"u","\u016f":"u","\u0171":"u","\u01d4":"u","\u0215":"u","\u0217":"u","\u01b0":"u","\u1eeb":"u","\u1ee9":"u","\u1eef":"u","\u1eed":"u","\u1ef1":"u","\u1ee5":"u","\u1e73":"u","\u0173":"u","\u1e77":"u","\u1e75":"u","\u0289":"u","\u24e5":"v","\uff56":"v","\u1e7d":"v","\u1e7f":"v","\u028b":"v","\ua75f":"v","\u028c":"v","\ua761":"vy","\u24e6":"w","\uff57":"w","\u1e81":"w","\u1e83":"w","\u0175":"w","\u1e87":"w","\u1e85":"w","\u1e98":"w","\u1e89":"w","\u2c73":"w","\u24e7":"x","\uff58":"x","\u1e8b":"x","\u1e8d":"x","\u24e8":"y","\uff59":"y","\u1ef3":"y","\xfd":"y","\u0177":"y","\u1ef9":"y","\u0233":"y","\u1e8f":"y","\xff":"y","\u1ef7":"y","\u1e99":"y","\u1ef5":"y","\u01b4":"y","\u024f":"y","\u1eff":"y","\u24e9":"z","\uff5a":"z","\u017a":"z","\u1e91":"z","\u017c":"z","\u017e":"z","\u1e93":"z","\u1e95":"z","\u01b6":"z","\u0225":"z","\u0240":"z","\u2c6c":"z","\ua763":"z","\u0386":"\u0391","\u0388":"\u0395","\u0389":"\u0397","\u038a":"\u0399","\u03aa":"\u0399","\u038c":"\u039f","\u038e":"\u03a5","\u03ab":"\u03a5","\u038f":"\u03a9","\u03ac":"\u03b1","\u03ad":"\u03b5","\u03ae":"\u03b7","\u03af":"\u03b9","\u03ca":"\u03b9","\u0390":"\u03b9","\u03cc":"\u03bf","\u03cd":"\u03c5","\u03cb":"\u03c5","\u03b0":"\u03c5","\u03c9":"\u03c9","\u03c2":"\u03c3"};i=a(document),f=function(){var a=1;return function(){return a++}}(),c=O(Object,{bind:function(a){var b=this;return function(){a.apply(b,arguments)}},init:function(c){var d,e,g=".select2-results";this.opts=c=this.prepareOpts(c),this.id=c.id,c.element.data("select2")!==b&&null!==c.element.data("select2")&&c.element.data("select2").destroy(),this.container=this.createContainer(),this.liveRegion=a(".select2-hidden-accessible"),0==this.liveRegion.length&&(this.liveRegion=a("<span>",{role:"status","aria-live":"polite"}).addClass("select2-hidden-accessible").appendTo(document.body)),this.containerId="s2id_"+(c.element.attr("id")||"autogen"+f()),this.containerEventName=this.containerId.replace(/([.])/g,"_").replace(/([;&,\-\.\+\*\~':"\!\^#$%@\[\]\(\)=>\|])/g,"\\$1"),this.container.attr("id",this.containerId),this.container.attr("title",c.element.attr("title")),this.body=a(document.body),D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.attr("style",c.element.attr("style")),this.container.css(K(c.containerCss,this.opts.element)),this.container.addClass(K(c.containerCssClass,this.opts.element)),this.elementTabIndex=this.opts.element.attr("tabindex"),this.opts.element.data("select2",this).attr("tabindex","-1").before(this.container).on("click.select2",A),this.container.data("select2",this),this.dropdown=this.container.find(".select2-drop"),D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(c.dropdownCssClass,this.opts.element)),this.dropdown.data("select2",this),this.dropdown.on("click",A),this.results=d=this.container.find(g),this.search=e=this.container.find("input.select2-input"),this.queryCount=0,this.resultsPage=0,this.context=null,this.initContainer(),this.container.on("click",A),v(this.results),this.dropdown.on("mousemove-filtered",g,this.bind(this.highlightUnderEvent)),this.dropdown.on("touchstart touchmove touchend",g,this.bind(function(a){this._touchEvent=!0,this.highlightUnderEvent(a)})),this.dropdown.on("touchmove",g,this.bind(this.touchMoved)),this.dropdown.on("touchstart touchend",g,this.bind(this.clearTouchMoved)),this.dropdown.on("click",this.bind(function(){this._touchEvent&&(this._touchEvent=!1,this.selectHighlighted())})),x(80,this.results),this.dropdown.on("scroll-debounced",g,this.bind(this.loadMoreIfNeeded)),a(this.container).on("change",".select2-input",function(a){a.stopPropagation()}),a(this.dropdown).on("change",".select2-input",function(a){a.stopPropagation()}),a.fn.mousewheel&&d.mousewheel(function(a,b,c,e){var f=d.scrollTop();e>0&&0>=f-e?(d.scrollTop(0),A(a)):0>e&&d.get(0).scrollHeight-d.scrollTop()+e<=d.height()&&(d.scrollTop(d.get(0).scrollHeight-d.height()),A(a))}),u(e),e.on("keyup-change input paste",this.bind(this.updateResults)),e.on("focus",function(){e.addClass("select2-focused")}),e.on("blur",function(){e.removeClass("select2-focused")}),this.dropdown.on("mouseup",g,this.bind(function(b){a(b.target).closest(".select2-result-selectable").length>0&&(this.highlightUnderEvent(b),this.selectHighlighted(b))})),this.dropdown.on("click mouseup mousedown touchstart touchend focusin",function(a){a.stopPropagation()}),this.nextSearchTerm=b,a.isFunction(this.opts.initSelection)&&(this.initSelection(),this.monitorSource()),null!==c.maximumInputLength&&this.search.attr("maxlength",c.maximumInputLength);var h=c.element.prop("disabled");h===b&&(h=!1),this.enable(!h);var i=c.element.prop("readonly");i===b&&(i=!1),this.readonly(i),j=j||q(),this.autofocus=c.element.prop("autofocus"),c.element.prop("autofocus",!1),this.autofocus&&this.focus(),this.search.attr("placeholder",c.searchInputPlaceholder)},destroy:function(){var a=this.opts.element,c=a.data("select2"),d=this;this.close(),a.length&&a[0].detachEvent&&d._sync&&a.each(function(){d._sync&&this.detachEvent("onpropertychange",d._sync)}),this.propertyObserver&&(this.propertyObserver.disconnect(),this.propertyObserver=null),this._sync=null,c!==b&&(c.container.remove(),c.liveRegion.remove(),c.dropdown.remove(),a.show().removeData("select2").off(".select2").prop("autofocus",this.autofocus||!1),this.elementTabIndex?a.attr({tabindex:this.elementTabIndex}):a.removeAttr("tabindex"),a.show()),N.call(this,"container","liveRegion","dropdown","results","search")},optionToData:function(a){return a.is("option")?{id:a.prop("value"),text:a.text(),element:a.get(),css:a.attr("class"),disabled:a.prop("disabled"),locked:r(a.attr("locked"),"locked")||r(a.data("locked"),!0)}:a.is("optgroup")?{text:a.attr("label"),children:[],element:a.get(),css:a.attr("class")}:void 0},prepareOpts:function(c){var d,e,g,h,i=this;if(d=c.element,"select"===d.get(0).tagName.toLowerCase()&&(this.select=e=c.element),e&&a.each(["id","multiple","ajax","query","createSearchChoice","initSelection","data","tags"],function(){if(this in c)throw new Error("Option '"+this+"' is not allowed for Select2 when attached to a <select> element.")}),c=a.extend({},{populateResults:function(d,e,g){var h,j=this.opts.id,k=this.liveRegion;h=function(d,e,l){var m,n,o,p,q,r,s,t,u,v;d=c.sortResults(d,e,g);var w=[];for(m=0,n=d.length;n>m;m+=1)o=d[m],q=o.disabled===!0,p=!q&&j(o)!==b,r=o.children&&o.children.length>0,s=a("<li></li>"),s.addClass("select2-results-dept-"+l),s.addClass("select2-result"),s.addClass(p?"select2-result-selectable":"select2-result-unselectable"),q&&s.addClass("select2-disabled"),r&&s.addClass("select2-result-with-children"),s.addClass(i.opts.formatResultCssClass(o)),s.attr("role","presentation"),t=a(document.createElement("div")),t.addClass("select2-result-label"),t.attr("id","select2-result-label-"+f()),t.attr("role","option"),v=c.formatResult(o,t,g,i.opts.escapeMarkup),v!==b&&(t.html(v),s.append(t)),r&&(u=a("<ul></ul>"),u.addClass("select2-result-sub"),h(o.children,u,l+1),s.append(u)),s.data("select2-data",o),w.push(s[0]);e.append(w),k.text(c.formatMatches(d.length))},h(e,d,0)}},a.fn.select2.defaults,c),"function"!=typeof c.id&&(g=c.id,c.id=function(a){return a[g]}),a.isArray(c.element.data("select2Tags"))){if("tags"in c)throw"tags specified as both an attribute 'data-select2-tags' and in options of Select2 "+c.element.attr("id");c.tags=c.element.data("select2Tags")}if(e?(c.query=this.bind(function(a){var f,g,h,c={results:[],more:!1},e=a.term;h=function(b,c){var d;b.is("option")?a.matcher(e,b.text(),b)&&c.push(i.optionToData(b)):b.is("optgroup")&&(d=i.optionToData(b),b.children().each2(function(a,b){h(b,d.children)}),d.children.length>0&&c.push(d))},f=d.children(),this.getPlaceholder()!==b&&f.length>0&&(g=this.getPlaceholderOption(),g&&(f=f.not(g))),f.each2(function(a,b){h(b,c.results)}),a.callback(c)}),c.id=function(a){return a.id}):"query"in c||("ajax"in c?(h=c.element.data("ajax-url"),h&&h.length>0&&(c.ajax.url=h),c.query=G.call(c.element,c.ajax)):"data"in c?c.query=H(c.data):"tags"in c&&(c.query=I(c.tags),c.createSearchChoice===b&&(c.createSearchChoice=function(b){return{id:a.trim(b),text:a.trim(b)}}),c.initSelection===b&&(c.initSelection=function(b,d){var e=[];a(s(b.val(),c.separator,c.transformVal)).each(function(){var b={id:this,text:this},d=c.tags;a.isFunction(d)&&(d=d()),a(d).each(function(){return r(this.id,b.id)?(b=this,!1):void 0}),e.push(b)}),d(e)}))),"function"!=typeof c.query)throw"query function not defined for Select2 "+c.element.attr("id");if("top"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.unshift(b)};else if("bottom"===c.createSearchChoicePosition)c.createSearchChoicePosition=function(a,b){a.push(b)};else if("function"!=typeof c.createSearchChoicePosition)throw"invalid createSearchChoicePosition option must be 'top', 'bottom' or a custom function";return c},monitorSource:function(){var d,c=this.opts.element,e=this;c.on("change.select2",this.bind(function(){this.opts.element.data("select2-change-triggered")!==!0&&this.initSelection()})),this._sync=this.bind(function(){var a=c.prop("disabled");a===b&&(a=!1),this.enable(!a);var d=c.prop("readonly");d===b&&(d=!1),this.readonly(d),this.container&&(D(this.container,this.opts.element,this.opts.adaptContainerCssClass),this.container.addClass(K(this.opts.containerCssClass,this.opts.element))),this.dropdown&&(D(this.dropdown,this.opts.element,this.opts.adaptDropdownCssClass),this.dropdown.addClass(K(this.opts.dropdownCssClass,this.opts.element)))}),c.length&&c[0].attachEvent&&c.each(function(){this.attachEvent("onpropertychange",e._sync)}),d=window.MutationObserver||window.WebKitMutationObserver||window.MozMutationObserver,d!==b&&(this.propertyObserver&&(delete this.propertyObserver,this.propertyObserver=null),this.propertyObserver=new d(function(b){a.each(b,e._sync)}),this.propertyObserver.observe(c.get(0),{attributes:!0,subtree:!1}))},triggerSelect:function(b){var c=a.Event("select2-selecting",{val:this.id(b),object:b,choice:b});return this.opts.element.trigger(c),!c.isDefaultPrevented()},triggerChange:function(b){b=b||{},b=a.extend({},b,{type:"change",val:this.val()}),this.opts.element.data("select2-change-triggered",!0),this.opts.element.trigger(b),this.opts.element.data("select2-change-triggered",!1),this.opts.element.click(),this.opts.blurOnChange&&this.opts.element.blur()},isInterfaceEnabled:function(){return this.enabledInterface===!0},enableInterface:function(){var a=this._enabled&&!this._readonly,b=!a;return a===this.enabledInterface?!1:(this.container.toggleClass("select2-container-disabled",b),this.close(),this.enabledInterface=a,!0)},enable:function(a){a===b&&(a=!0),this._enabled!==a&&(this._enabled=a,this.opts.element.prop("disabled",!a),this.enableInterface())},disable:function(){this.enable(!1)},readonly:function(a){a===b&&(a=!1),this._readonly!==a&&(this._readonly=a,this.opts.element.prop("readonly",a),this.enableInterface())},opened:function(){return this.container?this.container.hasClass("select2-dropdown-open"):!1},positionDropdown:function(){var v,w,x,y,z,b=this.dropdown,c=this.container,d=c.offset(),e=c.outerHeight(!1),f=c.outerWidth(!1),g=b.outerHeight(!1),h=a(window),i=h.width(),k=h.height(),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,p=m>=n+g,q=d.top-g>=h.scrollTop(),r=b.outerWidth(!1),s=function(){return l>=o+r},t=function(){return d.left+l+c.outerWidth(!1)>r},u=b.hasClass("select2-drop-above");u?(w=!0,!q&&p&&(x=!0,w=!1)):(w=!1,!p&&q&&(x=!0,w=!0)),x&&(b.hide(),d=this.container.offset(),e=this.container.outerHeight(!1),f=this.container.outerWidth(!1),g=b.outerHeight(!1),l=h.scrollLeft()+i,m=h.scrollTop()+k,n=d.top+e,o=d.left,r=b.outerWidth(!1),b.show(),this.focusSearch()),this.opts.dropdownAutoWidth?(z=a(".select2-results",b)[0],b.addClass("select2-drop-auto-width"),b.css("width",""),r=b.outerWidth(!1)+(z.scrollHeight===z.clientHeight?0:j.width),r>f?f=r:r=f,g=b.outerHeight(!1)):this.container.removeClass("select2-drop-auto-width"),"static"!==this.body.css("position")&&(v=this.body.offset(),n-=v.top,o-=v.left),!s()&&t()&&(o=d.left+this.container.outerWidth(!1)-r),y={left:o,width:f},w?(y.top=d.top-g,y.bottom="auto",this.container.addClass("select2-drop-above"),b.addClass("select2-drop-above")):(y.top=n,y.bottom="auto",this.container.removeClass("select2-drop-above"),b.removeClass("select2-drop-above")),y=a.extend(y,K(this.opts.dropdownCss,this.opts.element)),b.css(y)},shouldOpen:function(){var b;return this.opened()?!1:this._enabled===!1||this._readonly===!0?!1:(b=a.Event("select2-opening"),this.opts.element.trigger(b),!b.isDefaultPrevented())},clearDropdownAlignmentPreference:function(){this.container.removeClass("select2-drop-above"),this.dropdown.removeClass("select2-drop-above")},open:function(){return this.shouldOpen()?(this.opening(),i.on("mousemove.select2Event",function(a){h.x=a.pageX,h.y=a.pageY}),!0):!1},opening:function(){var f,b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.addClass("select2-dropdown-open").addClass("select2-container-active"),this.clearDropdownAlignmentPreference(),this.dropdown[0]!==this.body.children().last()[0]&&this.dropdown.detach().appendTo(this.body),f=a("#select2-drop-mask"),0===f.length&&(f=a(document.createElement("div")),f.attr("id","select2-drop-mask").attr("class","select2-drop-mask"),f.hide(),f.appendTo(this.body),f.on("mousedown touchstart click",function(b){n(f);var d,c=a("#select2-drop");c.length>0&&(d=c.data("select2"),d.opts.selectOnBlur&&d.selectHighlighted({noFocus:!0}),d.close(),b.preventDefault(),b.stopPropagation())})),this.dropdown.prev()[0]!==f[0]&&this.dropdown.before(f),a("#select2-drop").removeAttr("id"),this.dropdown.attr("id","select2-drop"),f.show(),this.positionDropdown(),this.dropdown.show(),this.positionDropdown(),this.dropdown.addClass("select2-drop-active");var g=this;this.container.parents().add(window).each(function(){a(this).on(d+" "+c+" "+e,function(){g.opened()&&g.positionDropdown()})})},close:function(){if(this.opened()){var b=this.containerEventName,c="scroll."+b,d="resize."+b,e="orientationchange."+b;this.container.parents().add(window).each(function(){a(this).off(c).off(d).off(e)}),this.clearDropdownAlignmentPreference(),a("#select2-drop-mask").hide(),this.dropdown.removeAttr("id"),this.dropdown.hide(),this.container.removeClass("select2-dropdown-open").removeClass("select2-container-active"),this.results.empty(),i.off("mousemove.select2Event"),this.clearSearch(),this.search.removeClass("select2-active"),this.opts.element.trigger(a.Event("select2-close"))}},externalSearch:function(a){this.open(),this.search.val(a),this.updateResults(!1)},clearSearch:function(){},getMaximumSelectionSize:function(){return K(this.opts.maximumSelectionSize,this.opts.element)},ensureHighlightVisible:function(){var c,d,e,f,g,h,i,j,b=this.results;if(d=this.highlight(),!(0>d)){if(0==d)return b.scrollTop(0),void 0;c=this.findHighlightableChoices().find(".select2-result-label"),e=a(c[d]),j=(e.offset()||{}).top||0,f=j+e.outerHeight(!0),d===c.length-1&&(i=b.find("li.select2-more-results"),i.length>0&&(f=i.offset().top+i.outerHeight(!0))),g=b.offset().top+b.outerHeight(!1),f>g&&b.scrollTop(b.scrollTop()+(f-g)),h=j-b.offset().top,0>h&&"none"!=e.css("display")&&b.scrollTop(b.scrollTop()+h)}},findHighlightableChoices:function(){return this.results.find(".select2-result-selectable:not(.select2-disabled):not(.select2-selected)")},moveHighlight:function(b){for(var c=this.findHighlightableChoices(),d=this.highlight();d>-1&&d<c.length;){d+=b; |
| | | var e=a(c[d]);if(e.hasClass("select2-result-selectable")&&!e.hasClass("select2-disabled")&&!e.hasClass("select2-selected")){this.highlight(d);break}}},highlight:function(b){var d,e,c=this.findHighlightableChoices();return 0===arguments.length?p(c.filter(".select2-highlighted")[0],c.get()):(b>=c.length&&(b=c.length-1),0>b&&(b=0),this.removeHighlight(),d=a(c[b]),d.addClass("select2-highlighted"),this.search.attr("aria-activedescendant",d.find(".select2-result-label").attr("id")),this.ensureHighlightVisible(),this.liveRegion.text(d.text()),e=d.data("select2-data"),e&&this.opts.element.trigger({type:"select2-highlight",val:this.id(e),choice:e}),void 0)},removeHighlight:function(){this.results.find(".select2-highlighted").removeClass("select2-highlighted")},touchMoved:function(){this._touchMoved=!0},clearTouchMoved:function(){this._touchMoved=!1},countSelectableResults:function(){return this.findHighlightableChoices().length},highlightUnderEvent:function(b){var c=a(b.target).closest(".select2-result-selectable");if(c.length>0&&!c.is(".select2-highlighted")){var d=this.findHighlightableChoices();this.highlight(d.index(c))}else 0==c.length&&this.removeHighlight()},loadMoreIfNeeded:function(){var c,a=this.results,b=a.find("li.select2-more-results"),d=this.resultsPage+1,e=this,f=this.search.val(),g=this.context;0!==b.length&&(c=b.offset().top-a.offset().top-a.height(),c<=this.opts.loadMorePadding&&(b.addClass("select2-active"),this.opts.query({element:this.opts.element,term:f,page:d,context:g,matcher:this.opts.matcher,callback:this.bind(function(c){e.opened()&&(e.opts.populateResults.call(this,a,c.results,{term:f,page:d,context:g}),e.postprocessResults(c,!1,!1),c.more===!0?(b.detach().appendTo(a).html(e.opts.escapeMarkup(K(e.opts.formatLoadMore,e.opts.element,d+1))),window.setTimeout(function(){e.loadMoreIfNeeded()},10)):b.remove(),e.positionDropdown(),e.resultsPage=d,e.context=c.context,this.opts.element.trigger({type:"select2-loaded",items:c}))})})))},tokenize:function(){},updateResults:function(c){function m(){d.removeClass("select2-active"),h.positionDropdown(),e.find(".select2-no-results,.select2-selection-limit,.select2-searching").length?h.liveRegion.text(e.text()):h.liveRegion.text(h.opts.formatMatches(e.find('.select2-result-selectable:not(".select2-selected")').length))}function n(a){e.html(a),m()}var g,i,l,d=this.search,e=this.results,f=this.opts,h=this,j=d.val(),k=a.data(this.container,"select2-last-term");if((c===!0||!k||!r(j,k))&&(a.data(this.container,"select2-last-term",j),c===!0||this.showSearchInput!==!1&&this.opened())){l=++this.queryCount;var o=this.getMaximumSelectionSize();if(o>=1&&(g=this.data(),a.isArray(g)&&g.length>=o&&J(f.formatSelectionTooBig,"formatSelectionTooBig")))return n("<li class='select2-selection-limit'>"+K(f.formatSelectionTooBig,f.element,o)+"</li>"),void 0;if(d.val().length<f.minimumInputLength)return J(f.formatInputTooShort,"formatInputTooShort")?n("<li class='select2-no-results'>"+K(f.formatInputTooShort,f.element,d.val(),f.minimumInputLength)+"</li>"):n(""),c&&this.showSearch&&this.showSearch(!0),void 0;if(f.maximumInputLength&&d.val().length>f.maximumInputLength)return J(f.formatInputTooLong,"formatInputTooLong")?n("<li class='select2-no-results'>"+K(f.formatInputTooLong,f.element,d.val(),f.maximumInputLength)+"</li>"):n(""),void 0;f.formatSearching&&0===this.findHighlightableChoices().length&&n("<li class='select2-searching'>"+K(f.formatSearching,f.element)+"</li>"),d.addClass("select2-active"),this.removeHighlight(),i=this.tokenize(),i!=b&&null!=i&&d.val(i),this.resultsPage=1,f.query({element:f.element,term:d.val(),page:this.resultsPage,context:null,matcher:f.matcher,callback:this.bind(function(g){var i;if(l==this.queryCount){if(!this.opened())return this.search.removeClass("select2-active"),void 0;if(g.hasError!==b&&J(f.formatAjaxError,"formatAjaxError"))return n("<li class='select2-ajax-error'>"+K(f.formatAjaxError,f.element,g.jqXHR,g.textStatus,g.errorThrown)+"</li>"),void 0;if(this.context=g.context===b?null:g.context,this.opts.createSearchChoice&&""!==d.val()&&(i=this.opts.createSearchChoice.call(h,d.val(),g.results),i!==b&&null!==i&&h.id(i)!==b&&null!==h.id(i)&&0===a(g.results).filter(function(){return r(h.id(this),h.id(i))}).length&&this.opts.createSearchChoicePosition(g.results,i)),0===g.results.length&&J(f.formatNoMatches,"formatNoMatches"))return n("<li class='select2-no-results'>"+K(f.formatNoMatches,f.element,d.val())+"</li>"),void 0;e.empty(),h.opts.populateResults.call(this,e,g.results,{term:d.val(),page:this.resultsPage,context:null}),g.more===!0&&J(f.formatLoadMore,"formatLoadMore")&&(e.append("<li class='select2-more-results'>"+f.escapeMarkup(K(f.formatLoadMore,f.element,this.resultsPage))+"</li>"),window.setTimeout(function(){h.loadMoreIfNeeded()},10)),this.postprocessResults(g,c),m(),this.opts.element.trigger({type:"select2-loaded",items:g})}})})}},cancel:function(){this.close()},blur:function(){this.opts.selectOnBlur&&this.selectHighlighted({noFocus:!0}),this.close(),this.container.removeClass("select2-container-active"),this.search[0]===document.activeElement&&this.search.blur(),this.clearSearch(),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus")},focusSearch:function(){y(this.search)},selectHighlighted:function(a){if(this._touchMoved)return this.clearTouchMoved(),void 0;var b=this.highlight(),c=this.results.find(".select2-highlighted"),d=c.closest(".select2-result").data("select2-data");d?(this.highlight(b),this.onSelect(d,a)):a&&a.noFocus&&this.close()},getPlaceholder:function(){var a;return this.opts.element.attr("placeholder")||this.opts.element.attr("data-placeholder")||this.opts.element.data("placeholder")||this.opts.placeholder||((a=this.getPlaceholderOption())!==b?a.text():b)},getPlaceholderOption:function(){if(this.select){var c=this.select.children("option").first();if(this.opts.placeholderOption!==b)return"first"===this.opts.placeholderOption&&c||"function"==typeof this.opts.placeholderOption&&this.opts.placeholderOption(this.select);if(""===a.trim(c.text())&&""===c.val())return c}},initContainerWidth:function(){function c(){var c,d,e,f,g,h;if("off"===this.opts.width)return null;if("element"===this.opts.width)return 0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px";if("copy"===this.opts.width||"resolve"===this.opts.width){if(c=this.opts.element.attr("style"),c!==b)for(d=c.split(";"),f=0,g=d.length;g>f;f+=1)if(h=d[f].replace(/\s/g,""),e=h.match(/^width:(([-+]?([0-9]*\.)?[0-9]+)(px|em|ex|%|in|cm|mm|pt|pc))/i),null!==e&&e.length>=1)return e[1];return"resolve"===this.opts.width?(c=this.opts.element.css("width"),c.indexOf("%")>0?c:0===this.opts.element.outerWidth(!1)?"auto":this.opts.element.outerWidth(!1)+"px"):null}return a.isFunction(this.opts.width)?this.opts.width():this.opts.width}var d=c.call(this);null!==d&&this.container.css("width",d)}}),d=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container"}).html(["<a href='javascript:void(0)' class='select2-choice' tabindex='-1'>"," <span class='select2-chosen'> </span><abbr class='select2-search-choice-close'></abbr>"," <span class='select2-arrow' role='presentation'><b role='presentation'></b></span>","</a>","<label for='' class='select2-offscreen'></label>","<input class='select2-focusser select2-offscreen' type='text' aria-haspopup='true' role='button' />","<div class='select2-drop select2-display-none'>"," <div class='select2-search'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input' role='combobox' aria-expanded='true'"," aria-autocomplete='list' />"," </div>"," <ul class='select2-results' role='listbox'>"," </ul>","</div>"].join(""));return b},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.focusser.prop("disabled",!this.isInterfaceEnabled())},opening:function(){var c,d,e;this.opts.minimumResultsForSearch>=0&&this.showSearch(!0),this.parent.opening.apply(this,arguments),this.showSearchInput!==!1&&this.search.val(this.focusser.val()),this.opts.shouldFocusInput(this)&&(this.search.focus(),c=this.search.get(0),c.createTextRange?(d=c.createTextRange(),d.collapse(!1),d.select()):c.setSelectionRange&&(e=this.search.val().length,c.setSelectionRange(e,e))),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.focusser.prop("disabled",!0).val(""),this.updateResults(!0),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&(this.parent.close.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},focus:function(){this.opened()?this.close():(this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus())},isFocused:function(){return this.container.hasClass("select2-container-active")},cancel:function(){this.parent.cancel.apply(this,arguments),this.focusser.prop("disabled",!1),this.opts.shouldFocusInput(this)&&this.focusser.focus()},destroy:function(){a("label[for='"+this.focusser.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"selection","focusser")},initContainer:function(){var b,g,c=this.container,d=this.dropdown,e=f();this.opts.minimumResultsForSearch<0?this.showSearch(!1):this.showSearch(!0),this.selection=b=c.find(".select2-choice"),this.focusser=c.find(".select2-focusser"),b.find(".select2-chosen").attr("id","select2-chosen-"+e),this.focusser.attr("aria-labelledby","select2-chosen-"+e),this.results.attr("id","select2-results-"+e),this.search.attr("aria-owns","select2-results-"+e),this.focusser.attr("id","s2id_autogen"+e),g=a("label[for='"+this.opts.element.attr("id")+"']"),this.opts.element.focus(this.bind(function(){this.focus()})),this.focusser.prev().text(g.text()).attr("for",this.focusser.attr("id"));var h=this.opts.element.attr("title");this.opts.element.attr("title",h||g.text()),this.focusser.attr("tabindex",this.elementTabIndex),this.search.attr("id",this.focusser.attr("id")+"_search"),this.search.prev().text(a("label[for='"+this.focusser.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&229!=a.keyCode){if(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)return A(a),void 0;switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),void 0;case k.ESC:return this.cancel(a),A(a),void 0}}})),this.search.on("blur",this.bind(function(){document.activeElement===this.body.get(0)&&window.setTimeout(this.bind(function(){this.opened()&&this.search.focus()}),0)})),this.focusser.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()&&a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.ESC){if(this.opts.openOnEnter===!1&&a.which===k.ENTER)return A(a),void 0;if(a.which==k.DOWN||a.which==k.UP||a.which==k.ENTER&&this.opts.openOnEnter){if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return;return this.open(),A(a),void 0}return a.which==k.DELETE||a.which==k.BACKSPACE?(this.opts.allowClear&&this.clear(),A(a),void 0):void 0}})),u(this.focusser),this.focusser.on("keyup-change input",this.bind(function(a){if(this.opts.minimumResultsForSearch>=0){if(a.stopPropagation(),this.opened())return;this.open()}})),b.on("mousedown touchstart","abbr",this.bind(function(a){this.isInterfaceEnabled()&&(this.clear(),B(a),this.close(),this.selection&&this.selection.focus())})),b.on("mousedown touchstart",this.bind(function(c){n(b),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.opened()?this.close():this.isInterfaceEnabled()&&this.open(),A(c)})),d.on("mousedown touchstart",this.bind(function(){this.opts.shouldFocusInput(this)&&this.search.focus()})),b.on("focus",this.bind(function(a){A(a)})),this.focusser.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})).on("blur",this.bind(function(){this.opened()||(this.container.removeClass("select2-container-active"),this.opts.element.trigger(a.Event("select2-blur")))})),this.search.on("focus",this.bind(function(){this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active")})),this.initContainerWidth(),this.opts.element.hide(),this.setPlaceholder()},clear:function(b){var c=this.selection.data("select2-data");if(c){var d=a.Event("select2-clearing");if(this.opts.element.trigger(d),d.isDefaultPrevented())return;var e=this.getPlaceholderOption();this.opts.element.val(e?e.val():""),this.selection.find(".select2-chosen").empty(),this.selection.removeData("select2-data"),this.setPlaceholder(),b!==!1&&(this.opts.element.trigger({type:"select2-removed",val:this.id(c),choice:c}),this.triggerChange({removed:c}))}},initSelection:function(){if(this.isPlaceholderOptionSelected())this.updateSelection(null),this.close(),this.setPlaceholder();else{var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.setPlaceholder(),c.nextSearchTerm=c.opts.nextSearchTerm(a,c.search.val()))})}},isPlaceholderOptionSelected:function(){var a;return this.getPlaceholder()===b?!1:(a=this.getPlaceholderOption())!==b&&a.prop("selected")||""===this.opts.element.val()||this.opts.element.val()===b||null===this.opts.element.val()},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=a.find("option").filter(function(){return this.selected&&!this.disabled});b(c.optionToData(d))}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=c.val(),f=null;b.query({matcher:function(a,c,d){var g=r(e,b.id(d));return g&&(f=d),g},callback:a.isFunction(d)?function(){d(f)}:a.noop})}),b},getPlaceholder:function(){return this.select&&this.getPlaceholderOption()===b?b:this.parent.getPlaceholder.apply(this,arguments)},setPlaceholder:function(){var a=this.getPlaceholder();if(this.isPlaceholderOptionSelected()&&a!==b){if(this.select&&this.getPlaceholderOption()===b)return;this.selection.find(".select2-chosen").html(this.opts.escapeMarkup(a)),this.selection.addClass("select2-default"),this.container.removeClass("select2-allowclear")}},postprocessResults:function(a,b,c){var d=0,e=this;if(this.findHighlightableChoices().each2(function(a,b){return r(e.id(b.data("select2-data")),e.opts.element.val())?(d=a,!1):void 0}),c!==!1&&(b===!0&&d>=0?this.highlight(d):this.highlight(0)),b===!0){var g=this.opts.minimumResultsForSearch;g>=0&&this.showSearch(L(a.results)>=g)}},showSearch:function(b){this.showSearchInput!==b&&(this.showSearchInput=b,this.dropdown.find(".select2-search").toggleClass("select2-search-hidden",!b),this.dropdown.find(".select2-search").toggleClass("select2-offscreen",!b),a(this.dropdown,this.container).toggleClass("select2-with-searchbox",b))},onSelect:function(a,b){if(this.triggerSelect(a)){var c=this.opts.element.val(),d=this.data();this.opts.element.val(this.id(a)),this.updateSelection(a),this.opts.element.trigger({type:"select2-selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.close(),b&&b.noFocus||!this.opts.shouldFocusInput(this)||this.focusser.focus(),r(c,this.id(a))||this.triggerChange({added:a,removed:d})}},updateSelection:function(a){var d,e,c=this.selection.find(".select2-chosen");this.selection.data("select2-data",a),c.empty(),null!==a&&(d=this.opts.formatSelection(a,c,this.opts.escapeMarkup)),d!==b&&c.append(d),e=this.opts.formatSelectionCssClass(a,c),e!==b&&c.addClass(e),this.selection.removeClass("select2-default"),this.opts.allowClear&&this.getPlaceholder()!==b&&this.container.addClass("select2-allowclear")},val:function(){var a,c=!1,d=null,e=this,f=this.data();if(0===arguments.length)return this.opts.element.val();if(a=arguments[0],arguments.length>1&&(c=arguments[1]),this.select)this.select.val(a).find("option").filter(function(){return this.selected}).each2(function(a,b){return d=e.optionToData(b),!1}),this.updateSelection(d),this.setPlaceholder(),c&&this.triggerChange({added:d,removed:f});else{if(!a&&0!==a)return this.clear(c),void 0;if(this.opts.initSelection===b)throw new Error("cannot call val() if initSelection() is not defined");this.opts.element.val(a),this.opts.initSelection(this.opts.element,function(a){e.opts.element.val(a?e.id(a):""),e.updateSelection(a),e.setPlaceholder(),c&&e.triggerChange({added:a,removed:f})})}},clearSearch:function(){this.search.val(""),this.focusser.val("")},data:function(a){var c,d=!1;return 0===arguments.length?(c=this.selection.data("select2-data"),c==b&&(c=null),c):(arguments.length>1&&(d=arguments[1]),a?(c=this.data(),this.opts.element.val(a?this.id(a):""),this.updateSelection(a),d&&this.triggerChange({added:a,removed:c})):this.clear(d),void 0)}}),e=O(c,{createContainer:function(){var b=a(document.createElement("div")).attr({"class":"select2-container select2-container-multi"}).html(["<ul class='select2-choices'>"," <li class='select2-search-field'>"," <label for='' class='select2-offscreen'></label>"," <input type='text' autocomplete='off' autocorrect='off' autocapitalize='off' spellcheck='false' class='select2-input'>"," </li>","</ul>","<div class='select2-drop select2-drop-multi select2-display-none'>"," <ul class='select2-results'>"," </ul>","</div>"].join(""));return b},prepareOpts:function(){var b=this.parent.prepareOpts.apply(this,arguments),c=this;return"select"===b.element.get(0).tagName.toLowerCase()?b.initSelection=function(a,b){var d=[];a.find("option").filter(function(){return this.selected&&!this.disabled}).each2(function(a,b){d.push(c.optionToData(b))}),b(d)}:"data"in b&&(b.initSelection=b.initSelection||function(c,d){var e=s(c.val(),b.separator,b.transformVal),f=[];b.query({matcher:function(c,d,g){var h=a.grep(e,function(a){return r(a,b.id(g))}).length;return h&&f.push(g),h},callback:a.isFunction(d)?function(){for(var a=[],c=0;c<e.length;c++)for(var g=e[c],h=0;h<f.length;h++){var i=f[h];if(r(g,b.id(i))){a.push(i),f.splice(h,1);break}}d(a)}:a.noop})}),b},selectChoice:function(a){var b=this.container.find(".select2-search-choice-focus");b.length&&a&&a[0]==b[0]||(b.length&&this.opts.element.trigger("choice-deselected",b),b.removeClass("select2-search-choice-focus"),a&&a.length&&(this.close(),a.addClass("select2-search-choice-focus"),this.opts.element.trigger("choice-selected",a)))},destroy:function(){a("label[for='"+this.search.attr("id")+"']").attr("for",this.opts.element.attr("id")),this.parent.destroy.apply(this,arguments),N.call(this,"searchContainer","selection")},initContainer:function(){var c,b=".select2-choices";this.searchContainer=this.container.find(".select2-search-field"),this.selection=c=this.container.find(b);var d=this;this.selection.on("click",".select2-container:not(.select2-container-disabled) .select2-search-choice:not(.select2-locked)",function(){d.search[0].focus(),d.selectChoice(a(this))}),this.search.attr("id","s2id_autogen"+f()),this.search.prev().text(a("label[for='"+this.opts.element.attr("id")+"']").text()).attr("for",this.search.attr("id")),this.opts.element.focus(this.bind(function(){this.focus()})),this.search.on("input paste",this.bind(function(){this.search.attr("placeholder")&&0==this.search.val().length||this.isInterfaceEnabled()&&(this.opened()||this.open())})),this.search.attr("tabindex",this.elementTabIndex),this.keydowns=0,this.search.on("keydown",this.bind(function(a){if(this.isInterfaceEnabled()){++this.keydowns;var b=c.find(".select2-search-choice-focus"),d=b.prev(".select2-search-choice:not(.select2-locked)"),e=b.next(".select2-search-choice:not(.select2-locked)"),f=z(this.search);if(b.length&&(a.which==k.LEFT||a.which==k.RIGHT||a.which==k.BACKSPACE||a.which==k.DELETE||a.which==k.ENTER)){var g=b;return a.which==k.LEFT&&d.length?g=d:a.which==k.RIGHT?g=e.length?e:null:a.which===k.BACKSPACE?this.unselect(b.first())&&(this.search.width(10),g=d.length?d:e):a.which==k.DELETE?this.unselect(b.first())&&(this.search.width(10),g=e.length?e:null):a.which==k.ENTER&&(g=null),this.selectChoice(g),A(a),g&&g.length||this.open(),void 0}if((a.which===k.BACKSPACE&&1==this.keydowns||a.which==k.LEFT)&&0==f.offset&&!f.length)return this.selectChoice(c.find(".select2-search-choice:not(.select2-locked)").last()),A(a),void 0;if(this.selectChoice(null),this.opened())switch(a.which){case k.UP:case k.DOWN:return this.moveHighlight(a.which===k.UP?-1:1),A(a),void 0;case k.ENTER:return this.selectHighlighted(),A(a),void 0;case k.TAB:return this.selectHighlighted({noFocus:!0}),this.close(),void 0;case k.ESC:return this.cancel(a),A(a),void 0}if(a.which!==k.TAB&&!k.isControl(a)&&!k.isFunctionKey(a)&&a.which!==k.BACKSPACE&&a.which!==k.ESC){if(a.which===k.ENTER){if(this.opts.openOnEnter===!1)return;if(a.altKey||a.ctrlKey||a.shiftKey||a.metaKey)return}this.open(),(a.which===k.PAGE_UP||a.which===k.PAGE_DOWN)&&A(a),a.which===k.ENTER&&A(a)}}})),this.search.on("keyup",this.bind(function(){this.keydowns=0,this.resizeSearch()})),this.search.on("blur",this.bind(function(b){this.container.removeClass("select2-container-active"),this.search.removeClass("select2-focused"),this.selectChoice(null),this.opened()||this.clearSearch(),b.stopImmediatePropagation(),this.opts.element.trigger(a.Event("select2-blur"))})),this.container.on("click",b,this.bind(function(b){this.isInterfaceEnabled()&&(a(b.target).closest(".select2-search-choice").length>0||(this.selectChoice(null),this.clearPlaceholder(),this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.open(),this.focusSearch(),b.preventDefault()))})),this.container.on("focus",b,this.bind(function(){this.isInterfaceEnabled()&&(this.container.hasClass("select2-container-active")||this.opts.element.trigger(a.Event("select2-focus")),this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"),this.clearPlaceholder())})),this.initContainerWidth(),this.opts.element.hide(),this.clearSearch()},enableInterface:function(){this.parent.enableInterface.apply(this,arguments)&&this.search.prop("disabled",!this.isInterfaceEnabled())},initSelection:function(){if(""===this.opts.element.val()&&""===this.opts.element.text()&&(this.updateSelection([]),this.close(),this.clearSearch()),this.select||""!==this.opts.element.val()){var c=this;this.opts.initSelection.call(null,this.opts.element,function(a){a!==b&&null!==a&&(c.updateSelection(a),c.close(),c.clearSearch())})}},clearSearch:function(){var a=this.getPlaceholder(),c=this.getMaxSearchWidth();a!==b&&0===this.getVal().length&&this.search.hasClass("select2-focused")===!1?(this.search.val(a).addClass("select2-default"),this.search.width(c>0?c:this.container.css("width"))):this.search.val("").width(10)},clearPlaceholder:function(){this.search.hasClass("select2-default")&&this.search.val("").removeClass("select2-default")},opening:function(){this.clearPlaceholder(),this.resizeSearch(),this.parent.opening.apply(this,arguments),this.focusSearch(),""===this.search.val()&&this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.search.select()),this.updateResults(!0),this.opts.shouldFocusInput(this)&&this.search.focus(),this.opts.element.trigger(a.Event("select2-open"))},close:function(){this.opened()&&this.parent.close.apply(this,arguments)},focus:function(){this.close(),this.search.focus()},isFocused:function(){return this.search.hasClass("select2-focused")},updateSelection:function(b){var c=[],d=[],e=this;a(b).each(function(){p(e.id(this),c)<0&&(c.push(e.id(this)),d.push(this))}),b=d,this.selection.find(".select2-search-choice").remove(),a(b).each(function(){e.addSelectedChoice(this)}),e.postprocessResults()},tokenize:function(){var a=this.search.val();a=this.opts.tokenizer.call(this,a,this.data(),this.bind(this.onSelect),this.opts),null!=a&&a!=b&&(this.search.val(a),a.length>0&&this.open())},onSelect:function(a,c){this.triggerSelect(a)&&""!==a.text&&(this.addSelectedChoice(a),this.opts.element.trigger({type:"selected",val:this.id(a),choice:a}),this.nextSearchTerm=this.opts.nextSearchTerm(a,this.search.val()),this.clearSearch(),this.updateResults(),(this.select||!this.opts.closeOnSelect)&&this.postprocessResults(a,!1,this.opts.closeOnSelect===!0),this.opts.closeOnSelect?(this.close(),this.search.width(10)):this.countSelectableResults()>0?(this.search.width(10),this.resizeSearch(),this.getMaximumSelectionSize()>0&&this.val().length>=this.getMaximumSelectionSize()?this.updateResults(!0):this.nextSearchTerm!=b&&(this.search.val(this.nextSearchTerm),this.updateResults(),this.search.select()),this.positionDropdown()):(this.close(),this.search.width(10)),this.triggerChange({added:a}),c&&c.noFocus||this.focusSearch())},cancel:function(){this.close(),this.focusSearch()},addSelectedChoice:function(c){var j,k,d=!c.locked,e=a("<li class='select2-search-choice'> <div></div> <a href='#' class='select2-search-choice-close' tabindex='-1'></a></li>"),f=a("<li class='select2-search-choice select2-locked'><div></div></li>"),g=d?e:f,h=this.id(c),i=this.getVal();j=this.opts.formatSelection(c,g.find("div"),this.opts.escapeMarkup),j!=b&&g.find("div").replaceWith(a("<div></div>").html(j)),k=this.opts.formatSelectionCssClass(c,g.find("div")),k!=b&&g.addClass(k),d&&g.find(".select2-search-choice-close").on("mousedown",A).on("click dblclick",this.bind(function(b){this.isInterfaceEnabled()&&(this.unselect(a(b.target)),this.selection.find(".select2-search-choice-focus").removeClass("select2-search-choice-focus"),A(b),this.close(),this.focusSearch())})).on("focus",this.bind(function(){this.isInterfaceEnabled()&&(this.container.addClass("select2-container-active"),this.dropdown.addClass("select2-drop-active"))})),g.data("select2-data",c),g.insertBefore(this.searchContainer),i.push(h),this.setVal(i)},unselect:function(b){var d,e,c=this.getVal();if(b=b.closest(".select2-search-choice"),0===b.length)throw"Invalid argument: "+b+". Must be .select2-search-choice";if(d=b.data("select2-data")){var f=a.Event("select2-removing");if(f.val=this.id(d),f.choice=d,this.opts.element.trigger(f),f.isDefaultPrevented())return!1;for(;(e=p(this.id(d),c))>=0;)c.splice(e,1),this.setVal(c),this.select&&this.postprocessResults();return b.remove(),this.opts.element.trigger({type:"select2-removed",val:this.id(d),choice:d}),this.triggerChange({removed:d}),!0}},postprocessResults:function(a,b,c){var d=this.getVal(),e=this.results.find(".select2-result"),f=this.results.find(".select2-result-with-children"),g=this;e.each2(function(a,b){var c=g.id(b.data("select2-data"));p(c,d)>=0&&(b.addClass("select2-selected"),b.find(".select2-result-selectable").addClass("select2-selected"))}),f.each2(function(a,b){b.is(".select2-result-selectable")||0!==b.find(".select2-result-selectable:not(.select2-selected)").length||b.addClass("select2-selected")}),-1==this.highlight()&&c!==!1&&this.opts.closeOnSelect===!0&&g.highlight(0),!this.opts.createSearchChoice&&!e.filter(".select2-result:not(.select2-selected)").length>0&&(!a||a&&!a.more&&0===this.results.find(".select2-no-results").length)&&J(g.opts.formatNoMatches,"formatNoMatches")&&this.results.append("<li class='select2-no-results'>"+K(g.opts.formatNoMatches,g.opts.element,g.search.val())+"</li>")},getMaxSearchWidth:function(){return this.selection.width()-t(this.search)},resizeSearch:function(){var a,b,c,d,e,f=t(this.search);a=C(this.search)+10,b=this.search.offset().left,c=this.selection.width(),d=this.selection.offset().left,e=c-(b-d)-f,a>e&&(e=c-f),40>e&&(e=c-f),0>=e&&(e=a),this.search.width(Math.floor(e))},getVal:function(){var a;return this.select?(a=this.select.val(),null===a?[]:a):(a=this.opts.element.val(),s(a,this.opts.separator,this.opts.transformVal))},setVal:function(b){var c;this.select?this.select.val(b):(c=[],a(b).each(function(){p(this,c)<0&&c.push(this)}),this.opts.element.val(0===c.length?"":c.join(this.opts.separator)))},buildChangeDetails:function(a,b){for(var b=b.slice(0),a=a.slice(0),c=0;c<b.length;c++)for(var d=0;d<a.length;d++)r(this.opts.id(b[c]),this.opts.id(a[d]))&&(b.splice(c,1),c>0&&c--,a.splice(d,1),d--);return{added:b,removed:a}},val:function(c,d){var e,f=this;if(0===arguments.length)return this.getVal();if(e=this.data(),e.length||(e=[]),!c&&0!==c)return this.opts.element.val(""),this.updateSelection([]),this.clearSearch(),d&&this.triggerChange({added:this.data(),removed:e}),void 0;if(this.setVal(c),this.select)this.opts.initSelection(this.select,this.bind(this.updateSelection)),d&&this.triggerChange(this.buildChangeDetails(e,this.data()));else{if(this.opts.initSelection===b)throw new Error("val() cannot be called if initSelection() is not defined");this.opts.initSelection(this.opts.element,function(b){var c=a.map(b,f.id);f.setVal(c),f.updateSelection(b),f.clearSearch(),d&&f.triggerChange(f.buildChangeDetails(e,f.data()))})}this.clearSearch()},onSortStart:function(){if(this.select)throw new Error("Sorting of elements is not supported when attached to <select>. Attach to <input type='hidden'/> instead.");this.search.width(0),this.searchContainer.hide()},onSortEnd:function(){var b=[],c=this;this.searchContainer.show(),this.searchContainer.appendTo(this.searchContainer.parent()),this.resizeSearch(),this.selection.find(".select2-search-choice").each(function(){b.push(c.opts.id(a(this).data("select2-data")))}),this.setVal(b),this.triggerChange()},data:function(b,c){var e,f,d=this;return 0===arguments.length?this.selection.children(".select2-search-choice").map(function(){return a(this).data("select2-data")}).get():(f=this.data(),b||(b=[]),e=a.map(b,function(a){return d.opts.id(a)}),this.setVal(e),this.updateSelection(b),this.clearSearch(),c&&this.triggerChange(this.buildChangeDetails(f,this.data())),void 0)}}),a.fn.select2=function(){var d,e,f,g,h,c=Array.prototype.slice.call(arguments,0),i=["val","destroy","opened","open","close","focus","isFocused","container","dropdown","onSortStart","onSortEnd","enable","disable","readonly","positionDropdown","data","search"],j=["opened","isFocused","container","dropdown"],k=["val","data"],l={search:"externalSearch"};return this.each(function(){if(0===c.length||"object"==typeof c[0])d=0===c.length?{}:a.extend({},c[0]),d.element=a(this),"select"===d.element.get(0).tagName.toLowerCase()?h=d.element.prop("multiple"):(h=d.multiple||!1,"tags"in d&&(d.multiple=h=!0)),e=h?new window.Select2["class"].multi:new window.Select2["class"].single,e.init(d);else{if("string"!=typeof c[0])throw"Invalid arguments to select2 plugin: "+c;if(p(c[0],i)<0)throw"Unknown method: "+c[0];if(g=b,e=a(this).data("select2"),e===b)return;if(f=c[0],"container"===f?g=e.container:"dropdown"===f?g=e.dropdown:(l[f]&&(f=l[f]),g=e[f].apply(e,c.slice(1))),p(c[0],j)>=0||p(c[0],k)>=0&&1==c.length)return!1}}),g===b?this:g},a.fn.select2.defaults={width:"copy",loadMorePadding:0,closeOnSelect:!0,openOnEnter:!0,containerCss:{},dropdownCss:{},containerCssClass:"",dropdownCssClass:"",formatResult:function(a,b,c,d){var e=[];return E(this.text(a),c.term,e,d),e.join("")},transformVal:function(b){return a.trim(b)},formatSelection:function(a,c,d){return a?d(this.text(a)):b},sortResults:function(a){return a},formatResultCssClass:function(a){return a.css},formatSelectionCssClass:function(){return b},minimumResultsForSearch:0,minimumInputLength:0,maximumInputLength:null,maximumSelectionSize:0,id:function(a){return a==b?null:a.id},text:function(b){return b&&this.data&&this.data.text?a.isFunction(this.data.text)?this.data.text(b):b[this.data.text]:b.text |
| | | },matcher:function(a,b){return o(""+b).toUpperCase().indexOf(o(""+a).toUpperCase())>=0},separator:",",tokenSeparators:[],tokenizer:M,escapeMarkup:F,blurOnChange:!1,selectOnBlur:!1,adaptContainerCssClass:function(a){return a},adaptDropdownCssClass:function(){return null},nextSearchTerm:function(){return b},searchInputPlaceholder:"",createSearchChoicePosition:"top",shouldFocusInput:function(a){var b="ontouchstart"in window||navigator.msMaxTouchPoints>0;return b?a.opts.minimumResultsForSearch<0?!1:!0:!0}},a.fn.select2.locales=[],a.fn.select2.locales.en={formatMatches:function(a){return 1===a?"One result is available, press enter to select it.":a+" results are available, use up and down arrow keys to navigate."},formatNoMatches:function(){return"No matches found"},formatAjaxError:function(){return"Loading failed"},formatInputTooShort:function(a,b){var c=b-a.length;return"Please enter "+c+" or more character"+(1==c?"":"s")},formatInputTooLong:function(a,b){var c=a.length-b;return"Please delete "+c+" character"+(1==c?"":"s")},formatSelectionTooBig:function(a){return"You can only select "+a+" item"+(1==a?"":"s")},formatLoadMore:function(){return"Loading more results\u2026"},formatSearching:function(){return"Searching\u2026"}},a.extend(a.fn.select2.defaults,a.fn.select2.locales.en),a.fn.select2.ajaxDefaults={transport:a.ajax,params:{type:"GET",cache:!1,dataType:"json"}},window.Select2={query:{ajax:G,local:H,tags:I},util:{debounce:w,markMatch:E,escapeMarkup:F,stripDiacritics:o},"class":{"abstract":c,single:d,multi:e}}}}(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Arabic translation. |
| | | * |
| | | * Author: Adel KEDJOUR <adel@kedjour.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ar'] = { |
| | | formatNoMatches: function () { return "لم يتم العثور على مطابقات"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; if (n == 1){ return "الرجاء إدخال حرف واحد على الأكثر"; } return n == 2 ? "الرجاء إدخال حرفين على الأكثر" : "الرجاء إدخال " + n + " على الأكثر"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; if (n == 1){ return "الرجاء إدخال حرف واحد على الأقل"; } return n == 2 ? "الرجاء إدخال حرفين على الأقل" : "الرجاء إدخال " + n + " على الأقل "; }, |
| | | formatSelectionTooBig: function (limit) { if (limit == 1){ return "يمكنك أن تختار إختيار واحد فقط"; } return limit == 2 ? "يمكنك أن تختار إختيارين فقط" : "يمكنك أن تختار " + limit + " إختيارات فقط"; }, |
| | | formatLoadMore: function (pageNumber) { return "تحميل المزيد من النتائج…"; }, |
| | | formatSearching: function () { return "البحث…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ar']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Azerbaijani translation. |
| | | * |
| | | * Author: Farhad Safarov <farhad.safarov@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['az'] = { |
| | | formatMatches: function (matches) { return matches + " nəticə mövcuddur, hərəkət etdirmək üçün yuxarı və aşağı düymələrindən istifadə edin."; }, |
| | | formatNoMatches: function () { return "Nəticə tapılmadı"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return n + " simvol daxil edin"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return n + " simvol silin"; }, |
| | | formatSelectionTooBig: function (limit) { return "Sadəcə " + limit + " element seçə bilərsiniz"; }, |
| | | formatLoadMore: function (pageNumber) { return "Daha çox nəticə yüklənir…"; }, |
| | | formatSearching: function () { return "Axtarılır…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['az']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Bulgarian translation. |
| | | * |
| | | * @author Lubomir Vikev <lubomirvikev@gmail.com> |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['bg'] = { |
| | | formatNoMatches: function () { return "Няма намерени съвпадения"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Моля въведете още " + n + " символ" + (n > 1 ? "а" : ""); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Моля въведете с " + n + " по-малко символ" + (n > 1 ? "а" : ""); }, |
| | | formatSelectionTooBig: function (limit) { return "Можете да направите до " + limit + (limit > 1 ? " избора" : " избор"); }, |
| | | formatLoadMore: function (pageNumber) { return "Зареждат се още…"; }, |
| | | formatSearching: function () { return "Търсене…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['bg']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Catalan translation. |
| | | * |
| | | * Author: David Planella <david.planella@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ca'] = { |
| | | formatNoMatches: function () { return "No s'ha trobat cap coincidència"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduïu " + n + " caràcter" + (n == 1 ? "" : "s") + " més"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Introduïu " + n + " caràcter" + (n == 1? "" : "s") + "menys"; }, |
| | | formatSelectionTooBig: function (limit) { return "Només podeu seleccionar " + limit + " element" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "S'estan carregant més resultats…"; }, |
| | | formatSearching: function () { return "S'està cercant…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ca']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Czech translation. |
| | | * |
| | | * Author: Michal Marek <ahoj@michal-marek.cz> |
| | | * Author - sklonovani: David Vallner <david@vallner.net> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | // use text for the numbers 2 through 4 |
| | | var smallNumbers = { |
| | | 2: function(masc) { return (masc ? "dva" : "dvě"); }, |
| | | 3: function() { return "tři"; }, |
| | | 4: function() { return "čtyři"; } |
| | | } |
| | | $.fn.select2.locales['cs'] = { |
| | | formatNoMatches: function () { return "Nenalezeny žádné položky"; }, |
| | | formatInputTooShort: function (input, min) { |
| | | var n = min - input.length; |
| | | if (n == 1) { |
| | | return "Prosím zadejte ještě jeden znak"; |
| | | } else if (n <= 4) { |
| | | return "Prosím zadejte ještě další "+smallNumbers[n](true)+" znaky"; |
| | | } else { |
| | | return "Prosím zadejte ještě dalších "+n+" znaků"; |
| | | } |
| | | }, |
| | | formatInputTooLong: function (input, max) { |
| | | var n = input.length - max; |
| | | if (n == 1) { |
| | | return "Prosím zadejte o jeden znak méně"; |
| | | } else if (n <= 4) { |
| | | return "Prosím zadejte o "+smallNumbers[n](true)+" znaky méně"; |
| | | } else { |
| | | return "Prosím zadejte o "+n+" znaků méně"; |
| | | } |
| | | }, |
| | | formatSelectionTooBig: function (limit) { |
| | | if (limit == 1) { |
| | | return "Můžete zvolit jen jednu položku"; |
| | | } else if (limit <= 4) { |
| | | return "Můžete zvolit maximálně "+smallNumbers[limit](false)+" položky"; |
| | | } else { |
| | | return "Můžete zvolit maximálně "+limit+" položek"; |
| | | } |
| | | }, |
| | | formatLoadMore: function (pageNumber) { return "Načítají se další výsledky…"; }, |
| | | formatSearching: function () { return "Vyhledávání…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['cs']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Danish translation. |
| | | * |
| | | * Author: Anders Jenbo <anders@jenbo.dk> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['da'] = { |
| | | formatNoMatches: function () { return "Ingen resultater fundet"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Angiv venligst " + n + " tegn mere"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Angiv venligst " + n + " tegn mindre"; }, |
| | | formatSelectionTooBig: function (limit) { return "Du kan kun vælge " + limit + " emne" + (limit === 1 ? "" : "r"); }, |
| | | formatLoadMore: function (pageNumber) { return "Indlæser flere resultater…"; }, |
| | | formatSearching: function () { return "Søger…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['da']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 German translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['de'] = { |
| | | formatNoMatches: function () { return "Keine Übereinstimmungen gefunden"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Bitte " + n + " Zeichen mehr eingeben"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Bitte " + n + " Zeichen weniger eingeben"; }, |
| | | formatSelectionTooBig: function (limit) { return "Sie können nur " + limit + " Eintr" + (limit === 1 ? "ag" : "äge") + " auswählen"; }, |
| | | formatLoadMore: function (pageNumber) { return "Lade mehr Ergebnisse…"; }, |
| | | formatSearching: function () { return "Suche…"; }, |
| | | formatMatches: function (matches) { return matches + " Ergebnis " + (matches > 1 ? "se" : "") + " verfügbar, zum Navigieren die Hoch-/Runter-Pfeiltasten verwenden."; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['de']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Greek translation. |
| | | * |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['el'] = { |
| | | formatNoMatches: function () { return "Δεν βρέθηκαν αποτελέσματα"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Παρακαλούμε εισάγετε " + n + " περισσότερο" + (n > 1 ? "υς" : "") + " χαρακτήρ" + (n > 1 ? "ες" : "α"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Παρακαλούμε διαγράψτε " + n + " χαρακτήρ" + (n > 1 ? "ες" : "α"); }, |
| | | formatSelectionTooBig: function (limit) { return "Μπορείτε να επιλέξετε μόνο " + limit + " αντικείμεν" + (limit > 1 ? "α" : "ο"); }, |
| | | formatLoadMore: function (pageNumber) { return "Φόρτωση περισσότερων…"; }, |
| | | formatSearching: function () { return "Αναζήτηση…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['el']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Spanish translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['es'] = { |
| | | formatMatches: function (matches) { if (matches === 1) { return "Un resultado disponible, presione enter para seleccionarlo."; } return matches + " resultados disponibles, use las teclas de dirección para navegar."; }, |
| | | formatNoMatches: function () { return "No se encontraron resultados"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Por favor, introduzca " + n + " car" + (n == 1? "ácter" : "acteres"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Por favor, elimine " + n + " car" + (n == 1? "ácter" : "acteres"); }, |
| | | formatSelectionTooBig: function (limit) { return "Sólo puede seleccionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "Cargando más resultados…"; }, |
| | | formatSearching: function () { return "Buscando…"; }, |
| | | formatAjaxError: function() { return "La carga falló"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['es']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Estonian translation. |
| | | * |
| | | * Author: Kuldar Kalvik <kuldar@kalvik.ee> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['et'] = { |
| | | formatNoMatches: function () { return "Tulemused puuduvad"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Sisesta " + n + " täht" + (n == 1 ? "" : "e") + " rohkem"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Sisesta " + n + " täht" + (n == 1? "" : "e") + " vähem"; }, |
| | | formatSelectionTooBig: function (limit) { return "Saad vaid " + limit + " tulemus" + (limit == 1 ? "e" : "t") + " valida"; }, |
| | | formatLoadMore: function (pageNumber) { return "Laen tulemusi.."; }, |
| | | formatSearching: function () { return "Otsin.."; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['et']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Basque translation. |
| | | * |
| | | * Author: Julen Ruiz Aizpuru <julenx at gmail dot com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['eu'] = { |
| | | formatNoMatches: function () { |
| | | return "Ez da bat datorrenik aurkitu"; |
| | | }, |
| | | formatInputTooShort: function (input, min) { |
| | | var n = min - input.length; |
| | | if (n === 1) { |
| | | return "Idatzi karaktere bat gehiago"; |
| | | } else { |
| | | return "Idatzi " + n + " karaktere gehiago"; |
| | | } |
| | | }, |
| | | formatInputTooLong: function (input, max) { |
| | | var n = input.length - max; |
| | | if (n === 1) { |
| | | return "Idatzi karaktere bat gutxiago"; |
| | | } else { |
| | | return "Idatzi " + n + " karaktere gutxiago"; |
| | | } |
| | | }, |
| | | formatSelectionTooBig: function (limit) { |
| | | if (limit === 1 ) { |
| | | return "Elementu bakarra hauta dezakezu"; |
| | | } else { |
| | | return limit + " elementu hauta ditzakezu soilik"; |
| | | } |
| | | }, |
| | | formatLoadMore: function (pageNumber) { |
| | | return "Emaitza gehiago kargatzen…"; |
| | | }, |
| | | formatSearching: function () { |
| | | return "Bilatzen…"; |
| | | } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['eu']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Persian translation. |
| | | * |
| | | * Author: Ali Choopan <choopan@arsh.co> |
| | | * Author: Ebrahim Byagowi <ebrahim@gnu.org> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['fa'] = { |
| | | formatMatches: function (matches) { return matches + " نتیجه موجود است، کلیدهای جهت بالا و پایین را برای گشتن استفاده کنید."; }, |
| | | formatNoMatches: function () { return "نتیجهای یافت نشد."; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "لطفاً " + n + " نویسه بیشتر وارد نمایید"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "لطفاً " + n + " نویسه را حذف کنید."; }, |
| | | formatSelectionTooBig: function (limit) { return "شما فقط میتوانید " + limit + " مورد را انتخاب کنید"; }, |
| | | formatLoadMore: function (pageNumber) { return "در حال بارگیری موارد بیشتر…"; }, |
| | | formatSearching: function () { return "در حال جستجو…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['fa']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Finnish translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | $.fn.select2.locales['fi'] = { |
| | | formatNoMatches: function () { |
| | | return "Ei tuloksia"; |
| | | }, |
| | | formatInputTooShort: function (input, min) { |
| | | var n = min - input.length; |
| | | return "Ole hyvä ja anna " + n + " merkkiä lisää"; |
| | | }, |
| | | formatInputTooLong: function (input, max) { |
| | | var n = input.length - max; |
| | | return "Ole hyvä ja anna " + n + " merkkiä vähemmän"; |
| | | }, |
| | | formatSelectionTooBig: function (limit) { |
| | | return "Voit valita ainoastaan " + limit + " kpl"; |
| | | }, |
| | | formatLoadMore: function (pageNumber) { |
| | | return "Ladataan lisää tuloksia…"; |
| | | }, |
| | | formatSearching: function () { |
| | | return "Etsitään…"; |
| | | } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['fi']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 French translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['fr'] = { |
| | | formatMatches: function (matches) { return matches + " résultats sont disponibles, utilisez les flèches haut et bas pour naviguer."; }, |
| | | formatNoMatches: function () { return "Aucun résultat trouvé"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Saisissez " + n + " caractère" + (n == 1? "" : "s") + " supplémentaire" + (n == 1? "" : "s") ; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Supprimez " + n + " caractère" + (n == 1? "" : "s"); }, |
| | | formatSelectionTooBig: function (limit) { return "Vous pouvez seulement sélectionner " + limit + " élément" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "Chargement de résultats supplémentaires…"; }, |
| | | formatSearching: function () { return "Recherche en cours…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['fr']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Galician translation |
| | | * |
| | | * Author: Leandro Regueiro <leandro.regueiro@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['gl'] = { |
| | | formatNoMatches: function () { |
| | | return "Non se atoparon resultados"; |
| | | }, |
| | | formatInputTooShort: function (input, min) { |
| | | var n = min - input.length; |
| | | if (n === 1) { |
| | | return "Engada un carácter"; |
| | | } else { |
| | | return "Engada " + n + " caracteres"; |
| | | } |
| | | }, |
| | | formatInputTooLong: function (input, max) { |
| | | var n = input.length - max; |
| | | if (n === 1) { |
| | | return "Elimine un carácter"; |
| | | } else { |
| | | return "Elimine " + n + " caracteres"; |
| | | } |
| | | }, |
| | | formatSelectionTooBig: function (limit) { |
| | | if (limit === 1 ) { |
| | | return "Só pode seleccionar un elemento"; |
| | | } else { |
| | | return "Só pode seleccionar " + limit + " elementos"; |
| | | } |
| | | }, |
| | | formatLoadMore: function (pageNumber) { |
| | | return "Cargando máis resultados…"; |
| | | }, |
| | | formatSearching: function () { |
| | | return "Buscando…"; |
| | | } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['gl']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Hebrew translation. |
| | | * |
| | | * Author: Yakir Sitbon <http://www.yakirs.net/> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['he'] = { |
| | | formatNoMatches: function () { return "לא נמצאו התאמות"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "נא להזין עוד " + n + " תווים נוספים"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "נא להזין פחות " + n + " תווים"; }, |
| | | formatSelectionTooBig: function (limit) { return "ניתן לבחור " + limit + " פריטים"; }, |
| | | formatLoadMore: function (pageNumber) { return "טוען תוצאות נוספות…"; }, |
| | | formatSearching: function () { return "מחפש…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['he']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Croatian translation. |
| | | * |
| | | * @author Edi Modrić <edi.modric@gmail.com> |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['hr'] = { |
| | | formatNoMatches: function () { return "Nema rezultata"; }, |
| | | formatInputTooShort: function (input, min) { return "Unesite još" + character(min - input.length); }, |
| | | formatInputTooLong: function (input, max) { return "Unesite" + character(input.length - max) + " manje"; }, |
| | | formatSelectionTooBig: function (limit) { return "Maksimalan broj odabranih stavki je " + limit; }, |
| | | formatLoadMore: function (pageNumber) { return "Učitavanje rezultata…"; }, |
| | | formatSearching: function () { return "Pretraga…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['hr']); |
| | | |
| | | function character (n) { |
| | | return " " + n + " znak" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "a" : "" : "ova"); |
| | | } |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Hungarian translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['hu'] = { |
| | | formatNoMatches: function () { return "Nincs találat."; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Túl rövid. Még " + n + " karakter hiányzik."; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Túl hosszú. " + n + " karakterrel több, mint kellene."; }, |
| | | formatSelectionTooBig: function (limit) { return "Csak " + limit + " elemet lehet kiválasztani."; }, |
| | | formatLoadMore: function (pageNumber) { return "Töltés…"; }, |
| | | formatSearching: function () { return "Keresés…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['hu']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Indonesian translation. |
| | | * |
| | | * Author: Ibrahim Yusuf <ibrahim7usuf@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['id'] = { |
| | | formatNoMatches: function () { return "Tidak ada data yang sesuai"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Masukkan " + n + " huruf lagi" + (n == 1 ? "" : "s"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Hapus " + n + " huruf" + (n == 1 ? "" : "s"); }, |
| | | formatSelectionTooBig: function (limit) { return "Anda hanya dapat memilih " + limit + " pilihan" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "Mengambil data…"; }, |
| | | formatSearching: function () { return "Mencari…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['id']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Icelandic translation. |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['is'] = { |
| | | formatNoMatches: function () { return "Ekkert fannst"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Vinsamlegast skrifið " + n + " staf" + (n > 1 ? "i" : "") + " í viðbót"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Vinsamlegast styttið texta um " + n + " staf" + (n > 1 ? "i" : ""); }, |
| | | formatSelectionTooBig: function (limit) { return "Þú getur aðeins valið " + limit + " atriði"; }, |
| | | formatLoadMore: function (pageNumber) { return "Sæki fleiri niðurstöður…"; }, |
| | | formatSearching: function () { return "Leita…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['is']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Italian translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['it'] = { |
| | | formatNoMatches: function () { return "Nessuna corrispondenza trovata"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Inserisci ancora " + n + " caratter" + (n == 1? "e" : "i"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Inserisci " + n + " caratter" + (n == 1? "e" : "i") + " in meno"; }, |
| | | formatSelectionTooBig: function (limit) { return "Puoi selezionare solo " + limit + " element" + (limit == 1 ? "o" : "i"); }, |
| | | formatLoadMore: function (pageNumber) { return "Caricamento in corso…"; }, |
| | | formatSearching: function () { return "Ricerca…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['it']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Japanese translation. |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ja'] = { |
| | | formatNoMatches: function () { return "該当なし"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "後" + n + "文字入れてください"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "検索文字列が" + n + "文字長すぎます"; }, |
| | | formatSelectionTooBig: function (limit) { return "最多で" + limit + "項目までしか選択できません"; }, |
| | | formatLoadMore: function (pageNumber) { return "読込中・・・"; }, |
| | | formatSearching: function () { return "検索中・・・"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ja']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Georgian (Kartuli) translation. |
| | | * |
| | | * Author: Dimitri Kurashvili dimakura@gmail.com |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ka'] = { |
| | | formatNoMatches: function () { return "ვერ მოიძებნა"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "გთხოვთ შეიყვანოთ კიდევ " + n + " სიმბოლო"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "გთხოვთ წაშალოთ " + n + " სიმბოლო"; }, |
| | | formatSelectionTooBig: function (limit) { return "თქვენ შეგიძლიათ მხოლოდ " + limit + " ჩანაწერის მონიშვნა"; }, |
| | | formatLoadMore: function (pageNumber) { return "შედეგის ჩატვირთვა…"; }, |
| | | formatSearching: function () { return "ძებნა…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ka']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Korean translation. |
| | | * |
| | | * @author Swen Mun <longfinfunnel@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ko'] = { |
| | | formatNoMatches: function () { return "결과 없음"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "너무 짧습니다. "+n+"글자 더 입력해주세요."; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "너무 깁니다. "+n+"글자 지워주세요."; }, |
| | | formatSelectionTooBig: function (limit) { return "최대 "+limit+"개까지만 선택하실 수 있습니다."; }, |
| | | formatLoadMore: function (pageNumber) { return "불러오는 중…"; }, |
| | | formatSearching: function () { return "검색 중…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ko']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Lithuanian translation. |
| | | * |
| | | * @author CRONUS Karmalakas <cronus dot karmalakas at gmail dot com> |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['lt'] = { |
| | | formatNoMatches: function () { return "Atitikmenų nerasta"; }, |
| | | formatInputTooShort: function (input, min) { return "Įrašykite dar" + character(min - input.length); }, |
| | | formatInputTooLong: function (input, max) { return "Pašalinkite" + character(input.length - max); }, |
| | | formatSelectionTooBig: function (limit) { |
| | | return "Jūs galite pasirinkti tik " + limit + " element" + ((limit%100 > 9 && limit%100 < 21) || limit%10 == 0 ? "ų" : limit%10 > 1 ? "us" : "ą"); |
| | | }, |
| | | formatLoadMore: function (pageNumber) { return "Kraunama daugiau rezultatų…"; }, |
| | | formatSearching: function () { return "Ieškoma…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['lt']); |
| | | |
| | | function character (n) { |
| | | return " " + n + " simbol" + ((n%100 > 9 && n%100 < 21) || n%10 == 0 ? "ių" : n%10 > 1 ? "ius" : "į"); |
| | | } |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Latvian translation. |
| | | * |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['lv'] = { |
| | | formatNoMatches: function () { return "Sakritību nav"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Lūdzu ievadiet vēl " + n + " simbol" + (n == 11 ? "us" : n%10 == 1 ? "u" : "us"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Lūdzu ievadiet par " + n + " simbol" + (n == 11 ? "iem" : n%10 == 1 ? "u" : "iem") + " mazāk"; }, |
| | | formatSelectionTooBig: function (limit) { return "Jūs varat izvēlēties ne vairāk kā " + limit + " element" + (limit == 11 ? "us" : limit%10 == 1 ? "u" : "us"); }, |
| | | formatLoadMore: function (pageNumber) { return "Datu ielāde…"; }, |
| | | formatSearching: function () { return "Meklēšana…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['lv']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Macedonian translation. |
| | | * |
| | | * Author: Marko Aleksic <psybaron@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['mk'] = { |
| | | formatNoMatches: function () { return "Нема пронајдено совпаѓања"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Ве молиме внесете уште " + n + " карактер" + (n == 1 ? "" : "и"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Ве молиме внесете " + n + " помалку карактер" + (n == 1? "" : "и"); }, |
| | | formatSelectionTooBig: function (limit) { return "Можете да изберете само " + limit + " ставк" + (limit == 1 ? "а" : "и"); }, |
| | | formatLoadMore: function (pageNumber) { return "Вчитување резултати…"; }, |
| | | formatSearching: function () { return "Пребарување…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['mk']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Malay translation. |
| | | * |
| | | * Author: Kepoweran <kepoweran@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ms'] = { |
| | | formatNoMatches: function () { return "Tiada padanan yang ditemui"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Sila masukkan " + n + " aksara lagi"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Sila hapuskan " + n + " aksara"; }, |
| | | formatSelectionTooBig: function (limit) { return "Anda hanya boleh memilih " + limit + " pilihan"; }, |
| | | formatLoadMore: function (pageNumber) { return "Sedang memuatkan keputusan…"; }, |
| | | formatSearching: function () { return "Mencari…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ms']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Norwegian Bokmål translation. |
| | | * |
| | | * Author: Torgeir Veimo <torgeir.veimo@gmail.com> |
| | | * Author: Bjørn Johansen <post@bjornjohansen.no> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['nb'] = { |
| | | formatMatches: function (matches) { if (matches === 1) { return "Ett resultat er tilgjengelig, trykk enter for å velge det."; } return matches + " resultater er tilgjengelig. Bruk piltastene opp og ned for å navigere."; }, |
| | | formatNoMatches: function () { return "Ingen treff"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Vennligst skriv inn " + n + (n>1 ? " flere tegn" : " tegn til"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Vennligst fjern " + n + " tegn"; }, |
| | | formatSelectionTooBig: function (limit) { return "Du kan velge maks " + limit + " elementer"; }, |
| | | formatLoadMore: function (pageNumber) { return "Laster flere resultater …"; }, |
| | | formatSearching: function () { return "Søker …"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['no']); |
| | | })(jQuery); |
| | | |
| New file |
| | |
| | | /** |
| | | * Select2 Dutch translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['nl'] = { |
| | | formatNoMatches: function () { return "Geen resultaten gevonden"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Vul nog " + n + " karakter" + (n == 1? "" : "s") + " in"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Haal " + n + " karakter" + (n == 1? "" : "s") + " weg"; }, |
| | | formatSelectionTooBig: function (limit) { return "Maximaal " + limit + " item" + (limit == 1 ? "" : "s") + " toegestaan"; }, |
| | | formatLoadMore: function (pageNumber) { return "Meer resultaten laden…"; }, |
| | | formatSearching: function () { return "Zoeken…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['nl']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Polish translation. |
| | | * |
| | | * @author Jan Kondratowicz <jan@kondratowicz.pl> |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | * @author Michał Połtyn <mike@poltyn.com> |
| | | * @author Damian Zajkowski <damian.zajkowski@gmail.com> |
| | | */ |
| | | (function($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['pl'] = { |
| | | formatNoMatches: function() { |
| | | return "Brak wyników"; |
| | | }, |
| | | formatInputTooShort: function(input, min) { |
| | | return "Wpisz co najmniej" + character(min - input.length, "znak", "i"); |
| | | }, |
| | | formatInputTooLong: function(input, max) { |
| | | return "Wpisana fraza jest za długa o" + character(input.length - max, "znak", "i"); |
| | | }, |
| | | formatSelectionTooBig: function(limit) { |
| | | return "Możesz zaznaczyć najwyżej" + character(limit, "element", "y"); |
| | | }, |
| | | formatLoadMore: function(pageNumber) { |
| | | return "Ładowanie wyników…"; |
| | | }, |
| | | formatSearching: function() { |
| | | return "Szukanie…"; |
| | | } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['pl']); |
| | | |
| | | function character(n, word, pluralSuffix) { |
| | | //Liczba pojedyncza - brak suffiksu |
| | | //jeden znak |
| | | //jeden element |
| | | var suffix = ''; |
| | | if (n > 1 && n < 5) { |
| | | //Liczaba mnoga ilość od 2 do 4 - własny suffiks |
| | | //Dwa znaki, trzy znaki, cztery znaki. |
| | | //Dwa elementy, trzy elementy, cztery elementy |
| | | suffix = pluralSuffix; |
| | | } else if (n == 0 || n >= 5) { |
| | | //Ilość 0 suffiks ów |
| | | //Liczaba mnoga w ilości 5 i więcej - suffiks ów (nie poprawny dla wszystkich wyrazów, np. 100 wiadomości) |
| | | //Zero znaków, Pięć znaków, sześć znaków, siedem znaków, osiem znaków. |
| | | //Zero elementów Pięć elementów, sześć elementów, siedem elementów, osiem elementów. |
| | | suffix = 'ów'; |
| | | } |
| | | return " " + n + " " + word + suffix; |
| | | } |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Brazilian Portuguese translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['pt-BR'] = { |
| | | formatNoMatches: function () { return "Nenhum resultado encontrado"; }, |
| | | formatAjaxError: function () { return "Erro na busca"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Digite " + (min == 1 ? "" : "mais") + " " + n + " caracter" + (n == 1? "" : "es"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " caracter" + (n == 1? "" : "es"); }, |
| | | formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "Carregando mais resultados…"; }, |
| | | formatSearching: function () { return "Buscando…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-BR']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Portuguese (Portugal) translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['pt-PT'] = { |
| | | formatNoMatches: function () { return "Nenhum resultado encontrado"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Introduza " + n + " car" + (n == 1 ? "ácter" : "acteres"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Apague " + n + " car" + (n == 1 ? "ácter" : "acteres"); }, |
| | | formatSelectionTooBig: function (limit) { return "Só é possível selecionar " + limit + " elemento" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "A carregar mais resultados…"; }, |
| | | formatSearching: function () { return "A pesquisar…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['pt-PT']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Romanian translation. |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ro'] = { |
| | | formatNoMatches: function () { return "Nu a fost găsit nimic"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Vă rugăm să introduceți incă " + n + " caracter" + (n == 1 ? "" : "e"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Vă rugăm să introduceți mai puțin de " + n + " caracter" + (n == 1? "" : "e"); }, |
| | | formatSelectionTooBig: function (limit) { return "Aveți voie să selectați cel mult " + limit + " element" + (limit == 1 ? "" : "e"); }, |
| | | formatLoadMore: function (pageNumber) { return "Se încarcă…"; }, |
| | | formatSearching: function () { return "Căutare…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ro']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Serbian translation. |
| | | * |
| | | * @author Limon Monte <limon.monte@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['rs'] = { |
| | | formatNoMatches: function () { return "Ništa nije pronađeno"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Ukucajte bar još " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Obrišite " + n + " simbol" + (n % 10 == 1 && n % 100 != 11 ? "" : "a"); }, |
| | | formatSelectionTooBig: function (limit) { return "Možete izabrati samo " + limit + " stavk" + (limit % 10 == 1 && limit % 100 != 11 ? "u" : (limit % 10 >= 2 && limit % 10 <= 4 && (limit % 100 < 12 || limit % 100 > 14)? "e" : "i")); }, |
| | | formatLoadMore: function (pageNumber) { return "Preuzimanje još rezultata…"; }, |
| | | formatSearching: function () { return "Pretraga…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['rs']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Russian translation. |
| | | * |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['ru'] = { |
| | | formatNoMatches: function () { return "Совпадений не найдено"; }, |
| | | formatInputTooShort: function (input, min) { return "Пожалуйста, введите еще хотя бы" + character(min - input.length); }, |
| | | formatInputTooLong: function (input, max) { return "Пожалуйста, введите на" + character(input.length - max) + " меньше"; }, |
| | | formatSelectionTooBig: function (limit) { return "Вы можете выбрать не более " + limit + " элемент" + (limit%10 == 1 && limit%100 != 11 ? "а" : "ов"); }, |
| | | formatLoadMore: function (pageNumber) { return "Загрузка данных…"; }, |
| | | formatSearching: function () { return "Поиск…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ru']); |
| | | |
| | | function character (n) { |
| | | return " " + n + " символ" + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 20) ? n%10 > 1 ? "a" : "" : "ов"); |
| | | } |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Slovak translation. |
| | | * |
| | | * Author: David Vallner <david@vallner.net> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | // use text for the numbers 2 through 4 |
| | | var smallNumbers = { |
| | | 2: function(masc) { return (masc ? "dva" : "dve"); }, |
| | | 3: function() { return "tri"; }, |
| | | 4: function() { return "štyri"; } |
| | | }; |
| | | $.fn.select2.locales['sk'] = { |
| | | formatNoMatches: function () { return "Nenašli sa žiadne položky"; }, |
| | | formatInputTooShort: function (input, min) { |
| | | var n = min - input.length; |
| | | if (n == 1) { |
| | | return "Prosím, zadajte ešte jeden znak"; |
| | | } else if (n <= 4) { |
| | | return "Prosím, zadajte ešte ďalšie "+smallNumbers[n](true)+" znaky"; |
| | | } else { |
| | | return "Prosím, zadajte ešte ďalších "+n+" znakov"; |
| | | } |
| | | }, |
| | | formatInputTooLong: function (input, max) { |
| | | var n = input.length - max; |
| | | if (n == 1) { |
| | | return "Prosím, zadajte o jeden znak menej"; |
| | | } else if (n >= 2 && n <= 4) { |
| | | return "Prosím, zadajte o "+smallNumbers[n](true)+" znaky menej"; |
| | | } else { |
| | | return "Prosím, zadajte o "+n+" znakov menej"; |
| | | } |
| | | }, |
| | | formatSelectionTooBig: function (limit) { |
| | | if (limit == 1) { |
| | | return "Môžete zvoliť len jednu položku"; |
| | | } else if (limit >= 2 && limit <= 4) { |
| | | return "Môžete zvoliť najviac "+smallNumbers[limit](false)+" položky"; |
| | | } else { |
| | | return "Môžete zvoliť najviac "+limit+" položiek"; |
| | | } |
| | | }, |
| | | formatLoadMore: function (pageNumber) { return "Načítavajú sa ďalšie výsledky…"; }, |
| | | formatSearching: function () { return "Vyhľadávanie…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['sk']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Swedish translation. |
| | | * |
| | | * Author: Jens Rantil <jens.rantil@telavox.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['sv'] = { |
| | | formatNoMatches: function () { return "Inga träffar"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Var god skriv in " + n + (n>1 ? " till tecken" : " tecken till"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Var god sudda ut " + n + " tecken"; }, |
| | | formatSelectionTooBig: function (limit) { return "Du kan max välja " + limit + " element"; }, |
| | | formatLoadMore: function (pageNumber) { return "Laddar fler resultat…"; }, |
| | | formatSearching: function () { return "Söker…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['sv']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Thai translation. |
| | | * |
| | | * Author: Atsawin Chaowanakritsanakul <joke@nakhon.net> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['th'] = { |
| | | formatNoMatches: function () { return "ไม่พบข้อมูล"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "โปรดพิมพ์เพิ่มอีก " + n + " ตัวอักษร"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "โปรดลบออก " + n + " ตัวอักษร"; }, |
| | | formatSelectionTooBig: function (limit) { return "คุณสามารถเลือกได้ไม่เกิน " + limit + " รายการ"; }, |
| | | formatLoadMore: function (pageNumber) { return "กำลังค้นข้อมูลเพิ่ม…"; }, |
| | | formatSearching: function () { return "กำลังค้นข้อมูล…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['th']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Turkish translation. |
| | | * |
| | | * Author: Salim KAYABAŞI <salim.kayabasi@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['tr'] = { |
| | | formatNoMatches: function () { return "Sonuç bulunamadı"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "En az " + n + " karakter daha girmelisiniz"; }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return n + " karakter azaltmalısınız"; }, |
| | | formatSelectionTooBig: function (limit) { return "Sadece " + limit + " seçim yapabilirsiniz"; }, |
| | | formatLoadMore: function (pageNumber) { return "Daha fazla…"; }, |
| | | formatSearching: function () { return "Aranıyor…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['tr']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Uyghur translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | $.fn.select2.locales['ug-CN'] = { |
| | | formatNoMatches: function () { return "ماس كېلىدىغان ئۇچۇر تېپىلمىدى"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "يەنە " + n + " ھەرپ كىرگۈزۈڭ";}, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "" + n + "ھەرپ ئۆچۈرۈڭ";}, |
| | | formatSelectionTooBig: function (limit) { return "ئەڭ كۆپ بولغاندا" + limit + " تال ئۇچۇر تاللىيالايسىز"; }, |
| | | formatLoadMore: function (pageNumber) { return "ئۇچۇرلار ئوقۇلىۋاتىدۇ…"; }, |
| | | formatSearching: function () { return "ئىزدەۋاتىدۇ…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['ug-CN']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Ukrainian translation. |
| | | * |
| | | * @author bigmihail <bigmihail@bigmir.net> |
| | | * @author Uriy Efremochkin <efremochkin@uriy.me> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['uk'] = { |
| | | formatMatches: function (matches) { return character(matches, "результат") + " знайдено, використовуйте клавіші зі стрілками вверх та вниз для навігації."; }, |
| | | formatNoMatches: function () { return "Нічого не знайдено"; }, |
| | | formatInputTooShort: function (input, min) { return "Введіть буль ласка ще " + character(min - input.length, "символ"); }, |
| | | formatInputTooLong: function (input, max) { return "Введіть буль ласка на " + character(input.length - max, "символ") + " менше"; }, |
| | | formatSelectionTooBig: function (limit) { return "Ви можете вибрати лише " + character(limit, "елемент"); }, |
| | | formatLoadMore: function (pageNumber) { return "Завантаження даних…"; }, |
| | | formatSearching: function () { return "Пошук…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['uk']); |
| | | |
| | | function character (n, word) { |
| | | return n + " " + word + (n%10 < 5 && n%10 > 0 && (n%100 < 5 || n%100 > 19) ? n%10 > 1 ? "и" : "" : "ів"); |
| | | } |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Vietnamese translation. |
| | | * |
| | | * Author: Long Nguyen <olragon@gmail.com> |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | |
| | | $.fn.select2.locales['vi'] = { |
| | | formatNoMatches: function () { return "Không tìm thấy kết quả"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "Vui lòng nhập nhiều hơn " + n + " ký tự" + (n == 1 ? "" : "s"); }, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "Vui lòng nhập ít hơn " + n + " ký tự" + (n == 1? "" : "s"); }, |
| | | formatSelectionTooBig: function (limit) { return "Chỉ có thể chọn được " + limit + " tùy chọn" + (limit == 1 ? "" : "s"); }, |
| | | formatLoadMore: function (pageNumber) { return "Đang lấy thêm kết quả…"; }, |
| | | formatSearching: function () { return "Đang tìm…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['vi']); |
| | | })(jQuery); |
| | | |
| New file |
| | |
| | | /** |
| | | * Select2 Chinese translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | $.fn.select2.locales['zh-CN'] = { |
| | | formatNoMatches: function () { return "没有找到匹配项"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "请再输入" + n + "个字符";}, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "请删掉" + n + "个字符";}, |
| | | formatSelectionTooBig: function (limit) { return "你只能选择最多" + limit + "项"; }, |
| | | formatLoadMore: function (pageNumber) { return "加载结果中…"; }, |
| | | formatSearching: function () { return "搜索中…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-CN']); |
| | | })(jQuery); |
| New file |
| | |
| | | /** |
| | | * Select2 Traditional Chinese translation |
| | | */ |
| | | (function ($) { |
| | | "use strict"; |
| | | $.fn.select2.locales['zh-TW'] = { |
| | | formatNoMatches: function () { return "沒有找到相符的項目"; }, |
| | | formatInputTooShort: function (input, min) { var n = min - input.length; return "請再輸入" + n + "個字元";}, |
| | | formatInputTooLong: function (input, max) { var n = input.length - max; return "請刪掉" + n + "個字元";}, |
| | | formatSelectionTooBig: function (limit) { return "你只能選擇最多" + limit + "項"; }, |
| | | formatLoadMore: function (pageNumber) { return "載入中…"; }, |
| | | formatSearching: function () { return "搜尋中…"; } |
| | | }; |
| | | |
| | | $.extend($.fn.select2.defaults, $.fn.select2.locales['zh-TW']); |
| | | })(jQuery); |
| | |
| | | <div class="form-group"> |
| | | <label for="dkim_private" class="col-sm-3 control-label">{tmpl_var name='dkim_private_txt'}</label> |
| | | <textarea name="dkim_private" id="dkim_private" rows='10' cols='30'>{tmpl_var name='dkim_private'}</textarea> |
| | | <a href="javascript:setRequest()">{tmpl_var name='dkim_generate_txt'}</a> |
| | | <a href="javascript:setRequest('create')">{tmpl_var name='dkim_generate_txt'}</a> |
| | | </div> |
| | | <div class="form-group"> |
| | | <textarea name="dkim_public" style="display:none;" id="dkim_public" rows='5' cols='30' readonly>{tmpl_var name='dkim_public'}</textarea> |
| New file |
| | |
| | | .form-control .select2-choice { |
| | | border: 0; |
| | | border-radius: 2px; |
| | | } |
| | | |
| | | .form-control .select2-choice .select2-arrow { |
| | | border-radius: 0 2px 2px 0; |
| | | } |
| | | |
| | | .form-control.select2-container { |
| | | height: auto !important; |
| | | padding: 0; |
| | | } |
| | | |
| | | .form-control.select2-container.select2-dropdown-open { |
| | | border-color: #5897FB; |
| | | border-radius: 3px 3px 0 0; |
| | | } |
| | | |
| | | .form-control .select2-container.select2-dropdown-open .select2-choices { |
| | | border-radius: 3px 3px 0 0; |
| | | } |
| | | |
| | | .form-control.select2-container .select2-choices { |
| | | border: 0 !important; |
| | | border-radius: 3px; |
| | | } |
| | | |
| | | .control-group.warning .select2-container .select2-choice, |
| | | .control-group.warning .select2-container .select2-choices, |
| | | .control-group.warning .select2-container-active .select2-choice, |
| | | .control-group.warning .select2-container-active .select2-choices, |
| | | .control-group.warning .select2-dropdown-open.select2-drop-above .select2-choice, |
| | | .control-group.warning .select2-dropdown-open.select2-drop-above .select2-choices, |
| | | .control-group.warning .select2-container-multi.select2-container-active .select2-choices { |
| | | border: 1px solid #C09853 !important; |
| | | } |
| | | |
| | | .control-group.warning .select2-container .select2-choice div { |
| | | border-left: 1px solid #C09853 !important; |
| | | background: #FCF8E3 !important; |
| | | } |
| | | |
| | | .control-group.error .select2-container .select2-choice, |
| | | .control-group.error .select2-container .select2-choices, |
| | | .control-group.error .select2-container-active .select2-choice, |
| | | .control-group.error .select2-container-active .select2-choices, |
| | | .control-group.error .select2-dropdown-open.select2-drop-above .select2-choice, |
| | | .control-group.error .select2-dropdown-open.select2-drop-above .select2-choices, |
| | | .control-group.error .select2-container-multi.select2-container-active .select2-choices { |
| | | border: 1px solid #B94A48 !important; |
| | | } |
| | | |
| | | .control-group.error .select2-container .select2-choice div { |
| | | border-left: 1px solid #B94A48 !important; |
| | | background: #F2DEDE !important; |
| | | } |
| | | |
| | | .control-group.info .select2-container .select2-choice, |
| | | .control-group.info .select2-container .select2-choices, |
| | | .control-group.info .select2-container-active .select2-choice, |
| | | .control-group.info .select2-container-active .select2-choices, |
| | | .control-group.info .select2-dropdown-open.select2-drop-above .select2-choice, |
| | | .control-group.info .select2-dropdown-open.select2-drop-above .select2-choices, |
| | | .control-group.info .select2-container-multi.select2-container-active .select2-choices { |
| | | border: 1px solid #3A87AD !important; |
| | | } |
| | | |
| | | .control-group.info .select2-container .select2-choice div { |
| | | border-left: 1px solid #3A87AD !important; |
| | | background: #D9EDF7 !important; |
| | | } |
| | | |
| | | .control-group.success .select2-container .select2-choice, |
| | | .control-group.success .select2-container .select2-choices, |
| | | .control-group.success .select2-container-active .select2-choice, |
| | | .control-group.success .select2-container-active .select2-choices, |
| | | .control-group.success .select2-dropdown-open.select2-drop-above .select2-choice, |
| | | .control-group.success .select2-dropdown-open.select2-drop-above .select2-choices, |
| | | .control-group.success .select2-container-multi.select2-container-active .select2-choices { |
| | | border: 1px solid #468847 !important; |
| | | } |
| | | |
| | | .control-group.success .select2-container .select2-choice div { |
| | | border-left: 1px solid #468847 !important; |
| | | background: #DFF0D8 !important; |
| | | } |
| New file |
| | |
| | | /* |
| | | Version: 3.5.2 Timestamp: Sat Nov 1 14:43:36 EDT 2014 |
| | | */ |
| | | .select2-container { |
| | | margin: 0; |
| | | position: relative; |
| | | display: inline-block; |
| | | /* inline-block for ie7 */ |
| | | zoom: 1; |
| | | *display: inline; |
| | | vertical-align: middle; |
| | | } |
| | | |
| | | .select2-container, |
| | | .select2-drop, |
| | | .select2-search, |
| | | .select2-search input { |
| | | /* |
| | | Force border-box so that % widths fit the parent |
| | | container without overlap because of margin/padding. |
| | | More Info : http://www.quirksmode.org/css/box.html |
| | | */ |
| | | -webkit-box-sizing: border-box; /* webkit */ |
| | | -moz-box-sizing: border-box; /* firefox */ |
| | | box-sizing: border-box; /* css3 */ |
| | | } |
| | | |
| | | .select2-container .select2-choice { |
| | | display: block; |
| | | height: 26px; |
| | | padding: 0 0 0 8px; |
| | | overflow: hidden; |
| | | position: relative; |
| | | |
| | | border: 1px solid #aaa; |
| | | white-space: nowrap; |
| | | line-height: 26px; |
| | | color: #444; |
| | | text-decoration: none; |
| | | |
| | | border-radius: 4px; |
| | | |
| | | background-clip: padding-box; |
| | | |
| | | -webkit-touch-callout: none; |
| | | -webkit-user-select: none; |
| | | -moz-user-select: none; |
| | | -ms-user-select: none; |
| | | user-select: none; |
| | | |
| | | background-color: #fff; |
| | | background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.5, #fff)); |
| | | background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 50%); |
| | | background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 50%); |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#ffffff', endColorstr = '#eeeeee', GradientType = 0); |
| | | background-image: linear-gradient(to top, #eee 0%, #fff 50%); |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-container .select2-choice { |
| | | padding: 0 8px 0 0; |
| | | } |
| | | |
| | | .select2-container.select2-drop-above .select2-choice { |
| | | border-bottom-color: #aaa; |
| | | |
| | | border-radius: 0 0 4px 4px; |
| | | |
| | | background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #eee), color-stop(0.9, #fff)); |
| | | background-image: -webkit-linear-gradient(center bottom, #eee 0%, #fff 90%); |
| | | background-image: -moz-linear-gradient(center bottom, #eee 0%, #fff 90%); |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffff', endColorstr='#eeeeee', GradientType=0); |
| | | background-image: linear-gradient(to bottom, #eee 0%, #fff 90%); |
| | | } |
| | | |
| | | .select2-container.select2-allowclear .select2-choice .select2-chosen { |
| | | margin-right: 42px; |
| | | } |
| | | |
| | | .select2-container .select2-choice > .select2-chosen { |
| | | margin-right: 26px; |
| | | display: block; |
| | | overflow: hidden; |
| | | |
| | | white-space: nowrap; |
| | | |
| | | text-overflow: ellipsis; |
| | | float: none; |
| | | width: auto; |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-container .select2-choice > .select2-chosen { |
| | | margin-left: 26px; |
| | | margin-right: 0; |
| | | } |
| | | |
| | | .select2-container .select2-choice abbr { |
| | | display: none; |
| | | width: 12px; |
| | | height: 12px; |
| | | position: absolute; |
| | | right: 24px; |
| | | top: 8px; |
| | | |
| | | font-size: 1px; |
| | | text-decoration: none; |
| | | |
| | | border: 0; |
| | | background: url('select2.png') right top no-repeat; |
| | | cursor: pointer; |
| | | outline: 0; |
| | | } |
| | | |
| | | .select2-container.select2-allowclear .select2-choice abbr { |
| | | display: inline-block; |
| | | } |
| | | |
| | | .select2-container .select2-choice abbr:hover { |
| | | background-position: right -11px; |
| | | cursor: pointer; |
| | | } |
| | | |
| | | .select2-drop-mask { |
| | | border: 0; |
| | | margin: 0; |
| | | padding: 0; |
| | | position: fixed; |
| | | left: 0; |
| | | top: 0; |
| | | min-height: 100%; |
| | | min-width: 100%; |
| | | height: auto; |
| | | width: auto; |
| | | opacity: 0; |
| | | z-index: 9998; |
| | | /* styles required for IE to work */ |
| | | background-color: #fff; |
| | | filter: alpha(opacity=0); |
| | | } |
| | | |
| | | .select2-drop { |
| | | width: 100%; |
| | | margin-top: -1px; |
| | | position: absolute; |
| | | z-index: 9999; |
| | | top: 100%; |
| | | |
| | | background: #fff; |
| | | color: #000; |
| | | border: 1px solid #aaa; |
| | | border-top: 0; |
| | | |
| | | border-radius: 0 0 4px 4px; |
| | | |
| | | -webkit-box-shadow: 0 4px 5px rgba(0, 0, 0, .15); |
| | | box-shadow: 0 4px 5px rgba(0, 0, 0, .15); |
| | | } |
| | | |
| | | .select2-drop.select2-drop-above { |
| | | margin-top: 1px; |
| | | border-top: 1px solid #aaa; |
| | | border-bottom: 0; |
| | | |
| | | border-radius: 4px 4px 0 0; |
| | | |
| | | -webkit-box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); |
| | | box-shadow: 0 -4px 5px rgba(0, 0, 0, .15); |
| | | } |
| | | |
| | | .select2-drop-active { |
| | | border: 1px solid #5897fb; |
| | | border-top: none; |
| | | } |
| | | |
| | | .select2-drop.select2-drop-above.select2-drop-active { |
| | | border-top: 1px solid #5897fb; |
| | | } |
| | | |
| | | .select2-drop-auto-width { |
| | | border-top: 1px solid #aaa; |
| | | width: auto; |
| | | } |
| | | |
| | | .select2-drop-auto-width .select2-search { |
| | | padding-top: 4px; |
| | | } |
| | | |
| | | .select2-container .select2-choice .select2-arrow { |
| | | display: inline-block; |
| | | width: 18px; |
| | | height: 100%; |
| | | position: absolute; |
| | | right: 0; |
| | | top: 0; |
| | | |
| | | border-left: 1px solid #aaa; |
| | | border-radius: 0 4px 4px 0; |
| | | |
| | | background-clip: padding-box; |
| | | |
| | | background: #ccc; |
| | | background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #ccc), color-stop(0.6, #eee)); |
| | | background-image: -webkit-linear-gradient(center bottom, #ccc 0%, #eee 60%); |
| | | background-image: -moz-linear-gradient(center bottom, #ccc 0%, #eee 60%); |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr = '#eeeeee', endColorstr = '#cccccc', GradientType = 0); |
| | | background-image: linear-gradient(to top, #ccc 0%, #eee 60%); |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-container .select2-choice .select2-arrow { |
| | | left: 0; |
| | | right: auto; |
| | | |
| | | border-left: none; |
| | | border-right: 1px solid #aaa; |
| | | border-radius: 4px 0 0 4px; |
| | | } |
| | | |
| | | .select2-container .select2-choice .select2-arrow b { |
| | | display: block; |
| | | width: 100%; |
| | | height: 100%; |
| | | background: url('select2.png') no-repeat 0 1px; |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-container .select2-choice .select2-arrow b { |
| | | background-position: 2px 1px; |
| | | } |
| | | |
| | | .select2-search { |
| | | display: inline-block; |
| | | width: 100%; |
| | | min-height: 26px; |
| | | margin: 0; |
| | | padding-left: 4px; |
| | | padding-right: 4px; |
| | | |
| | | position: relative; |
| | | z-index: 10000; |
| | | |
| | | white-space: nowrap; |
| | | } |
| | | |
| | | .select2-search input { |
| | | width: 100%; |
| | | height: auto !important; |
| | | min-height: 26px; |
| | | padding: 4px 20px 4px 5px; |
| | | margin: 0; |
| | | |
| | | outline: 0; |
| | | font-family: sans-serif; |
| | | font-size: 1em; |
| | | |
| | | border: 1px solid #aaa; |
| | | border-radius: 0; |
| | | |
| | | -webkit-box-shadow: none; |
| | | box-shadow: none; |
| | | |
| | | background: #fff url('select2.png') no-repeat 100% -22px; |
| | | background: url('select2.png') no-repeat 100% -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); |
| | | background: url('select2.png') no-repeat 100% -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); |
| | | background: url('select2.png') no-repeat 100% -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); |
| | | background: url('select2.png') no-repeat 100% -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-search input { |
| | | padding: 4px 5px 4px 20px; |
| | | |
| | | background: #fff url('select2.png') no-repeat -37px -22px; |
| | | background: url('select2.png') no-repeat -37px -22px, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); |
| | | background: url('select2.png') no-repeat -37px -22px, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); |
| | | background: url('select2.png') no-repeat -37px -22px, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); |
| | | background: url('select2.png') no-repeat -37px -22px, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; |
| | | } |
| | | |
| | | .select2-drop.select2-drop-above .select2-search input { |
| | | margin-top: 4px; |
| | | } |
| | | |
| | | .select2-search input.select2-active { |
| | | background: #fff url('select2-spinner.gif') no-repeat 100%; |
| | | background: url('select2-spinner.gif') no-repeat 100%, -webkit-gradient(linear, left bottom, left top, color-stop(0.85, #fff), color-stop(0.99, #eee)); |
| | | background: url('select2-spinner.gif') no-repeat 100%, -webkit-linear-gradient(center bottom, #fff 85%, #eee 99%); |
| | | background: url('select2-spinner.gif') no-repeat 100%, -moz-linear-gradient(center bottom, #fff 85%, #eee 99%); |
| | | background: url('select2-spinner.gif') no-repeat 100%, linear-gradient(to bottom, #fff 85%, #eee 99%) 0 0; |
| | | } |
| | | |
| | | .select2-container-active .select2-choice, |
| | | .select2-container-active .select2-choices { |
| | | border: 1px solid #5897fb; |
| | | outline: none; |
| | | |
| | | -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); |
| | | box-shadow: 0 0 5px rgba(0, 0, 0, .3); |
| | | } |
| | | |
| | | .select2-dropdown-open .select2-choice { |
| | | border-bottom-color: transparent; |
| | | -webkit-box-shadow: 0 1px 0 #fff inset; |
| | | box-shadow: 0 1px 0 #fff inset; |
| | | |
| | | border-bottom-left-radius: 0; |
| | | border-bottom-right-radius: 0; |
| | | |
| | | background-color: #eee; |
| | | background-image: -webkit-gradient(linear, left bottom, left top, color-stop(0, #fff), color-stop(0.5, #eee)); |
| | | background-image: -webkit-linear-gradient(center bottom, #fff 0%, #eee 50%); |
| | | background-image: -moz-linear-gradient(center bottom, #fff 0%, #eee 50%); |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); |
| | | background-image: linear-gradient(to top, #fff 0%, #eee 50%); |
| | | } |
| | | |
| | | .select2-dropdown-open.select2-drop-above .select2-choice, |
| | | .select2-dropdown-open.select2-drop-above .select2-choices { |
| | | border: 1px solid #5897fb; |
| | | border-top-color: transparent; |
| | | |
| | | background-image: -webkit-gradient(linear, left top, left bottom, color-stop(0, #fff), color-stop(0.5, #eee)); |
| | | background-image: -webkit-linear-gradient(center top, #fff 0%, #eee 50%); |
| | | background-image: -moz-linear-gradient(center top, #fff 0%, #eee 50%); |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#ffffff', GradientType=0); |
| | | background-image: linear-gradient(to bottom, #fff 0%, #eee 50%); |
| | | } |
| | | |
| | | .select2-dropdown-open .select2-choice .select2-arrow { |
| | | background: transparent; |
| | | border-left: none; |
| | | filter: none; |
| | | } |
| | | html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow { |
| | | border-right: none; |
| | | } |
| | | |
| | | .select2-dropdown-open .select2-choice .select2-arrow b { |
| | | background-position: -18px 1px; |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-dropdown-open .select2-choice .select2-arrow b { |
| | | background-position: -16px 1px; |
| | | } |
| | | |
| | | .select2-hidden-accessible { |
| | | border: 0; |
| | | clip: rect(0 0 0 0); |
| | | height: 1px; |
| | | margin: -1px; |
| | | overflow: hidden; |
| | | padding: 0; |
| | | position: absolute; |
| | | width: 1px; |
| | | } |
| | | |
| | | /* results */ |
| | | .select2-results { |
| | | max-height: 200px; |
| | | padding: 0 0 0 4px; |
| | | margin: 4px 4px 4px 0; |
| | | position: relative; |
| | | overflow-x: hidden; |
| | | overflow-y: auto; |
| | | -webkit-tap-highlight-color: rgba(0, 0, 0, 0); |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-results { |
| | | padding: 0 4px 0 0; |
| | | margin: 4px 0 4px 4px; |
| | | } |
| | | |
| | | .select2-results ul.select2-result-sub { |
| | | margin: 0; |
| | | padding-left: 0; |
| | | } |
| | | |
| | | .select2-results li { |
| | | list-style: none; |
| | | display: list-item; |
| | | background-image: none; |
| | | } |
| | | |
| | | .select2-results li.select2-result-with-children > .select2-result-label { |
| | | font-weight: bold; |
| | | } |
| | | |
| | | .select2-results .select2-result-label { |
| | | padding: 3px 7px 4px; |
| | | margin: 0; |
| | | cursor: pointer; |
| | | |
| | | min-height: 1em; |
| | | |
| | | -webkit-touch-callout: none; |
| | | -webkit-user-select: none; |
| | | -moz-user-select: none; |
| | | -ms-user-select: none; |
| | | user-select: none; |
| | | } |
| | | |
| | | .select2-results-dept-1 .select2-result-label { padding-left: 20px } |
| | | .select2-results-dept-2 .select2-result-label { padding-left: 40px } |
| | | .select2-results-dept-3 .select2-result-label { padding-left: 60px } |
| | | .select2-results-dept-4 .select2-result-label { padding-left: 80px } |
| | | .select2-results-dept-5 .select2-result-label { padding-left: 100px } |
| | | .select2-results-dept-6 .select2-result-label { padding-left: 110px } |
| | | .select2-results-dept-7 .select2-result-label { padding-left: 120px } |
| | | |
| | | .select2-results .select2-highlighted { |
| | | background: #3875d7; |
| | | color: #fff; |
| | | } |
| | | |
| | | .select2-results li em { |
| | | background: #feffde; |
| | | font-style: normal; |
| | | } |
| | | |
| | | .select2-results .select2-highlighted em { |
| | | background: transparent; |
| | | } |
| | | |
| | | .select2-results .select2-highlighted ul { |
| | | background: #fff; |
| | | color: #000; |
| | | } |
| | | |
| | | .select2-results .select2-no-results, |
| | | .select2-results .select2-searching, |
| | | .select2-results .select2-ajax-error, |
| | | .select2-results .select2-selection-limit { |
| | | background: #f4f4f4; |
| | | display: list-item; |
| | | padding-left: 5px; |
| | | } |
| | | |
| | | /* |
| | | disabled look for disabled choices in the results dropdown |
| | | */ |
| | | .select2-results .select2-disabled.select2-highlighted { |
| | | color: #666; |
| | | background: #f4f4f4; |
| | | display: list-item; |
| | | cursor: default; |
| | | } |
| | | .select2-results .select2-disabled { |
| | | background: #f4f4f4; |
| | | display: list-item; |
| | | cursor: default; |
| | | } |
| | | |
| | | .select2-results .select2-selected { |
| | | display: none; |
| | | } |
| | | |
| | | .select2-more-results.select2-active { |
| | | background: #f4f4f4 url('select2-spinner.gif') no-repeat 100%; |
| | | } |
| | | |
| | | .select2-results .select2-ajax-error { |
| | | background: rgba(255, 50, 50, .2); |
| | | } |
| | | |
| | | .select2-more-results { |
| | | background: #f4f4f4; |
| | | display: list-item; |
| | | } |
| | | |
| | | /* disabled styles */ |
| | | |
| | | .select2-container.select2-container-disabled .select2-choice { |
| | | background-color: #f4f4f4; |
| | | background-image: none; |
| | | border: 1px solid #ddd; |
| | | cursor: default; |
| | | } |
| | | |
| | | .select2-container.select2-container-disabled .select2-choice .select2-arrow { |
| | | background-color: #f4f4f4; |
| | | background-image: none; |
| | | border-left: 0; |
| | | } |
| | | |
| | | .select2-container.select2-container-disabled .select2-choice abbr { |
| | | display: none; |
| | | } |
| | | |
| | | |
| | | /* multiselect */ |
| | | |
| | | .select2-container-multi .select2-choices { |
| | | height: auto !important; |
| | | height: 1%; |
| | | margin: 0; |
| | | padding: 0 5px 0 0; |
| | | position: relative; |
| | | |
| | | border: 1px solid #aaa; |
| | | cursor: text; |
| | | overflow: hidden; |
| | | |
| | | background-color: #fff; |
| | | background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(1%, #eee), color-stop(15%, #fff)); |
| | | background-image: -webkit-linear-gradient(top, #eee 1%, #fff 15%); |
| | | background-image: -moz-linear-gradient(top, #eee 1%, #fff 15%); |
| | | background-image: linear-gradient(to bottom, #eee 1%, #fff 15%); |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-container-multi .select2-choices { |
| | | padding: 0 0 0 5px; |
| | | } |
| | | |
| | | .select2-locked { |
| | | padding: 3px 5px 3px 5px !important; |
| | | } |
| | | |
| | | .select2-container-multi .select2-choices { |
| | | min-height: 26px; |
| | | } |
| | | |
| | | .select2-container-multi.select2-container-active .select2-choices { |
| | | border: 1px solid #5897fb; |
| | | outline: none; |
| | | |
| | | -webkit-box-shadow: 0 0 5px rgba(0, 0, 0, .3); |
| | | box-shadow: 0 0 5px rgba(0, 0, 0, .3); |
| | | } |
| | | .select2-container-multi .select2-choices li { |
| | | float: left; |
| | | list-style: none; |
| | | } |
| | | html[dir="rtl"] .select2-container-multi .select2-choices li |
| | | { |
| | | float: right; |
| | | } |
| | | .select2-container-multi .select2-choices .select2-search-field { |
| | | margin: 0; |
| | | padding: 0; |
| | | white-space: nowrap; |
| | | } |
| | | |
| | | .select2-container-multi .select2-choices .select2-search-field input { |
| | | padding: 5px; |
| | | margin: 1px 0; |
| | | |
| | | font-family: sans-serif; |
| | | font-size: 100%; |
| | | color: #666; |
| | | outline: 0; |
| | | border: 0; |
| | | -webkit-box-shadow: none; |
| | | box-shadow: none; |
| | | background: transparent !important; |
| | | } |
| | | |
| | | .select2-container-multi .select2-choices .select2-search-field input.select2-active { |
| | | background: #fff url('select2-spinner.gif') no-repeat 100% !important; |
| | | } |
| | | |
| | | .select2-default { |
| | | color: #999 !important; |
| | | } |
| | | |
| | | .select2-container-multi .select2-choices .select2-search-choice { |
| | | padding: 3px 5px 3px 18px; |
| | | margin: 3px 0 3px 5px; |
| | | position: relative; |
| | | |
| | | line-height: 13px; |
| | | color: #333; |
| | | cursor: default; |
| | | border: 1px solid #aaaaaa; |
| | | |
| | | border-radius: 3px; |
| | | |
| | | -webkit-box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); |
| | | box-shadow: 0 0 2px #fff inset, 0 1px 0 rgba(0, 0, 0, 0.05); |
| | | |
| | | background-clip: padding-box; |
| | | |
| | | -webkit-touch-callout: none; |
| | | -webkit-user-select: none; |
| | | -moz-user-select: none; |
| | | -ms-user-select: none; |
| | | user-select: none; |
| | | |
| | | background-color: #e4e4e4; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#eeeeee', endColorstr='#f4f4f4', GradientType=0); |
| | | background-image: -webkit-gradient(linear, 0% 0%, 0% 100%, color-stop(20%, #f4f4f4), color-stop(50%, #f0f0f0), color-stop(52%, #e8e8e8), color-stop(100%, #eee)); |
| | | background-image: -webkit-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); |
| | | background-image: -moz-linear-gradient(top, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); |
| | | background-image: linear-gradient(to bottom, #f4f4f4 20%, #f0f0f0 50%, #e8e8e8 52%, #eee 100%); |
| | | } |
| | | html[dir="rtl"] .select2-container-multi .select2-choices .select2-search-choice |
| | | { |
| | | margin: 3px 5px 3px 0; |
| | | padding: 3px 18px 3px 5px; |
| | | } |
| | | .select2-container-multi .select2-choices .select2-search-choice .select2-chosen { |
| | | cursor: default; |
| | | } |
| | | .select2-container-multi .select2-choices .select2-search-choice-focus { |
| | | background: #d4d4d4; |
| | | } |
| | | |
| | | .select2-search-choice-close { |
| | | display: block; |
| | | width: 12px; |
| | | height: 13px; |
| | | position: absolute; |
| | | right: 3px; |
| | | top: 4px; |
| | | |
| | | font-size: 1px; |
| | | outline: none; |
| | | background: url('select2.png') right top no-repeat; |
| | | } |
| | | html[dir="rtl"] .select2-search-choice-close { |
| | | right: auto; |
| | | left: 3px; |
| | | } |
| | | |
| | | .select2-container-multi .select2-search-choice-close { |
| | | left: 3px; |
| | | } |
| | | |
| | | html[dir="rtl"] .select2-container-multi .select2-search-choice-close { |
| | | left: auto; |
| | | right: 2px; |
| | | } |
| | | |
| | | .select2-container-multi .select2-choices .select2-search-choice .select2-search-choice-close:hover { |
| | | background-position: right -11px; |
| | | } |
| | | .select2-container-multi .select2-choices .select2-search-choice-focus .select2-search-choice-close { |
| | | background-position: right -11px; |
| | | } |
| | | |
| | | /* disabled styles */ |
| | | .select2-container-multi.select2-container-disabled .select2-choices { |
| | | background-color: #f4f4f4; |
| | | background-image: none; |
| | | border: 1px solid #ddd; |
| | | cursor: default; |
| | | } |
| | | |
| | | .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice { |
| | | padding: 3px 5px 3px 5px; |
| | | border: 1px solid #ddd; |
| | | background-image: none; |
| | | background-color: #f4f4f4; |
| | | } |
| | | |
| | | .select2-container-multi.select2-container-disabled .select2-choices .select2-search-choice .select2-search-choice-close { display: none; |
| | | background: none; |
| | | } |
| | | /* end multiselect */ |
| | | |
| | | |
| | | .select2-result-selectable .select2-match, |
| | | .select2-result-unselectable .select2-match { |
| | | text-decoration: underline; |
| | | } |
| | | |
| | | .select2-offscreen, .select2-offscreen:focus { |
| | | clip: rect(0 0 0 0) !important; |
| | | width: 1px !important; |
| | | height: 1px !important; |
| | | border: 0 !important; |
| | | margin: 0 !important; |
| | | padding: 0 !important; |
| | | overflow: hidden !important; |
| | | position: absolute !important; |
| | | outline: 0 !important; |
| | | left: 0px !important; |
| | | top: 0px !important; |
| | | } |
| | | |
| | | .select2-display-none { |
| | | display: none; |
| | | } |
| | | |
| | | .select2-measure-scrollbar { |
| | | position: absolute; |
| | | top: -10000px; |
| | | left: -10000px; |
| | | width: 100px; |
| | | height: 100px; |
| | | overflow: scroll; |
| | | } |
| | | |
| | | /* Retina-ize icons */ |
| | | |
| | | @media only screen and (-webkit-min-device-pixel-ratio: 1.5), only screen and (min-resolution: 2dppx) { |
| | | .select2-search input, |
| | | .select2-search-choice-close, |
| | | .select2-container .select2-choice abbr, |
| | | .select2-container .select2-choice .select2-arrow b { |
| | | background-image: url('select2x2.png') !important; |
| | | background-repeat: no-repeat !important; |
| | | background-size: 60px 40px !important; |
| | | } |
| | | |
| | | .select2-search input { |
| | | background-position: 100% -21px !important; |
| | | } |
| | | } |
| | |
| | | <link rel='stylesheet' href='themes/<tmpl_var name='current_theme'>/assets/stylesheets/pushy.min.css' /> |
| | | <link rel='stylesheet' href='themes/<tmpl_var name='current_theme'>/assets/stylesheets/responsive.min.css' /> |
| | | <link rel='stylesheet' href='themes/<tmpl_var name='current_theme'>/assets/stylesheets/themes/default/theme.min.css' /> |
| | | <link rel='stylesheet' href='themes/<tmpl_var name='current_theme'>/assets/stylesheets/select2.css' /> |
| | | <link rel='stylesheet' href='themes/<tmpl_var name='current_theme'>/assets/stylesheets/select2-bootstrap.css' /> |
| | | <link href="themes/<tmpl_var name='current_theme'>/assets/stylesheets/jquery-ui-1.11.1.min.css" rel="stylesheet" type="text/css" /> |
| | | <link href="themes/<tmpl_var name='current_theme'>/assets/stylesheets/jquery-ui-1.11.1.structure.min.css" rel="stylesheet" type="text/css" /> |
| | | <link href="themes/<tmpl_var name='current_theme'>/assets/stylesheets/jquery-ui-1.11.1.theme.min.css" rel="stylesheet" type="text/css" /> |
| | |
| | | </div> |
| | | |
| | | <script type="text/javascript" src="js/jquery-2.1.1.min.js"></script> |
| | | <script type="text/javascript" src="js/jquery-ui-1.11.1.custom.min.js"></script> |
| | | <script src='themes/<tmpl_var name='current_theme'>/assets/javascripts/bootstrap.min.js'></script> |
| | | <script src='themes/<tmpl_var name='current_theme'>/assets/javascripts/ispconfig.min.js'></script> |
| | | <script src='themes/<tmpl_var name='current_theme'>/assets/javascripts/modernizr.custom.min.js'></script> |
| | | <script src='themes/<tmpl_var name='current_theme'>/assets/javascripts/pushy.min.js'></script> |
| | | <script src='themes/<tmpl_var name='current_theme'>/assets/javascripts/responsive.min.js'></script> |
| | | <script src='js/select2/select2.min.js'></script> |
| | | <script src='js/scrigo.js.php'></script> |
| | | <script type="text/javascript" src="js/jquery.ispconfigsearch.js"></script> |
| | | <script type="text/javascript" src="js/jquery.tipsy.js"></script> |
| | | <script type="text/javascript" src="js/jquery.combobox.js"></script> |
| | | <tmpl_loop name="js_d_includes"> |
| | | <script type="text/javascript" src="js/js.d/<tmpl_var name='file'>"></script> |
| | | </tmpl_loop> |